C32H37N7O6S — CID 89305630
methyl 2-[4-[[(5S,8aS)-7-[(2-amino-1,3-benzothiazol-4-yl)methyl]-1-[butylcarbamoyl(prop-2-ynyl)amino]-3,6-dioxo-2,5,8,8a-tetrahydroimidazo[1,2-a]pyrazin-5-yl]methyl]phenoxy]acetate (PubChem CID 89305630) has the molecular formula C32H37N7O6S and a molecular weight of 647.76 g/mol. Its IUPAC name is methyl 2-[4-[[(5S,8aS)-7-[(2-amino-1,3-benzothiazol-4-yl)methyl]-1-[butylcarbamoyl(prop-2-ynyl)amino]-3,6-dioxo-2,5,8,8a-tetrahydroimidazo[1,2-a]pyrazin-5-yl]methyl]phenoxy]acetate.
| Compound Name | methyl 2-[4-[[(5S,8aS)-7-[(2-amino-1,3-benzothiazol-4-yl)methyl]-1-[butylcarbamoyl(prop-2-ynyl)amino]-3,6-dioxo-2,5,8,8a-tetrahydroimidazo[1,2-a]pyrazin-5-yl]methyl]phenoxy]acetate |
|---|---|
| PubChem CID | 89305630 |
| Molecular Formula | C32H37N7O6S |
| Molecular Weight | 647.76 g/mol |
| Exact Mass | 647.25 |
| IUPAC Name | methyl 2-[4-[[(5S,8aS)-7-[(2-amino-1,3-benzothiazol-4-yl)methyl]-1-[butylcarbamoyl(prop-2-ynyl)amino]-3,6-dioxo-2,5,8,8a-tetrahydroimidazo[1,2-a]pyrazin-5-yl]methyl]phenoxy]acetate |
| SMILES | C#CCN(C(=O)NCCCC)N1CC(=O)N2[C@@H](Cc3ccc(OCC(=O)OC)cc3)C(=O)N(Cc3cccc4sc(N)nc34)C[C@@H]21 |
| InChI | InChI=1S/C32H37N7O6S/c1-4-6-14-34-32(43)37(15-5-2)38-19-27(40)39-24(16-21-10-12-23(13-11-21)45-20-28(41)44-3)30(42)36(18-26(38)39)17-22-8-7-9-25-29(22)35-31(33)46-25/h2,7-13,24,26H,4,6,14-20H2,1,3H3,(H2,33,35)(H,34,43)/t24-,26+/m0/s1 |
| InChIKey | URJPRTVNOHXZSB-AZGAKELHSA-N |
| XLogP | 2.21 |
| TPSA | 150.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 46 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 647.76 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|