C22H27N7O3S — CID 89168584
1-[(8aS)-7-[(2-amino-1,3-benzothiazol-4-yl)methyl]-3,6-dioxo-2,5,8,8a-tetrahydroimidazo[1,2-a]pyrazin-1-yl]-3-butyl-1-prop-2-ynylurea (PubChem CID 89168584) has the molecular formula C22H27N7O3S and a molecular weight of 469.57 g/mol. Its IUPAC name is 1-[(8aS)-7-[(2-amino-1,3-benzothiazol-4-yl)methyl]-3,6-dioxo-2,5,8,8a-tetrahydroimidazo[1,2-a]pyrazin-1-yl]-3-butyl-1-prop-2-ynylurea.
| Compound Name | 1-[(8aS)-7-[(2-amino-1,3-benzothiazol-4-yl)methyl]-3,6-dioxo-2,5,8,8a-tetrahydroimidazo[1,2-a]pyrazin-1-yl]-3-butyl-1-prop-2-ynylurea |
|---|---|
| PubChem CID | 89168584 |
| Molecular Formula | C22H27N7O3S |
| Molecular Weight | 469.57 g/mol |
| Exact Mass | 469.19 |
| IUPAC Name | 1-[(8aS)-7-[(2-amino-1,3-benzothiazol-4-yl)methyl]-3,6-dioxo-2,5,8,8a-tetrahydroimidazo[1,2-a]pyrazin-1-yl]-3-butyl-1-prop-2-ynylurea |
| SMILES | C#CCN(C(=O)NCCCC)N1CC(=O)N2CC(=O)N(Cc3cccc4sc(N)nc34)C[C@@H]21 |
| InChI | InChI=1S/C22H27N7O3S/c1-3-5-9-24-22(32)28(10-4-2)29-14-19(31)27-13-18(30)26(12-17(27)29)11-15-7-6-8-16-20(15)25-21(23)33-16/h2,6-8,17H,3,5,9-14H2,1H3,(H2,23,25)(H,24,32)/t17-/m0/s1 |
| InChIKey | MCBAMAGATKLGLD-KRWDZBQOSA-N |
| XLogP | 1.05 |
| TPSA | 115.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.57 |
| LogP ≤ 5 | 1.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|