C25H26N8O4S — CID 89301771
1-[(8aS)-7-[(2-amino-1,3-benzothiazol-4-yl)methyl]-3,6-dioxo-2,5,8,8a-tetrahydroimidazo[1,2-a]pyrazin-1-yl]-1-(cyanomethyl)-3-[(4-methoxyphenyl)methyl]urea (PubChem CID 89301771) has the molecular formula C25H26N8O4S and a molecular weight of 534.60 g/mol. Its IUPAC name is 1-[(8aS)-7-[(2-amino-1,3-benzothiazol-4-yl)methyl]-3,6-dioxo-2,5,8,8a-tetrahydroimidazo[1,2-a]pyrazin-1-yl]-1-(cyanomethyl)-3-[(4-methoxyphenyl)methyl]urea.
| Compound Name | 1-[(8aS)-7-[(2-amino-1,3-benzothiazol-4-yl)methyl]-3,6-dioxo-2,5,8,8a-tetrahydroimidazo[1,2-a]pyrazin-1-yl]-1-(cyanomethyl)-3-[(4-methoxyphenyl)methyl]urea |
|---|---|
| PubChem CID | 89301771 |
| Molecular Formula | C25H26N8O4S |
| Molecular Weight | 534.60 g/mol |
| Exact Mass | 534.18 |
| IUPAC Name | 1-[(8aS)-7-[(2-amino-1,3-benzothiazol-4-yl)methyl]-3,6-dioxo-2,5,8,8a-tetrahydroimidazo[1,2-a]pyrazin-1-yl]-1-(cyanomethyl)-3-[(4-methoxyphenyl)methyl]urea |
| SMILES | COc1ccc(CNC(=O)N(CC#N)N2CC(=O)N3CC(=O)N(Cc4cccc5sc(N)nc45)C[C@@H]32)cc1 |
| InChI | InChI=1S/C25H26N8O4S/c1-37-18-7-5-16(6-8-18)11-28-25(36)32(10-9-26)33-15-22(35)31-14-21(34)30(13-20(31)33)12-17-3-2-4-19-23(17)29-24(27)38-19/h2-8,20H,10-15H2,1H3,(H2,27,29)(H,28,36)/t20-/m0/s1 |
| InChIKey | KJGQCWHBUWZSJV-FQEVSTJZSA-N |
| XLogP | 1.35 |
| TPSA | 148.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.60 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'cyanamide', 'substructure': 'N/A'} |
|---|