C25H26FN7O3S — CID 89302132
1-[(8aS)-7-[(2-amino-1,3-benzothiazol-4-yl)methyl]-3,6-dioxo-2,5,8,8a-tetrahydroimidazo[1,2-a]pyrazin-1-yl]-3-[(4-fluorophenyl)methyl]-1-prop-2-enylurea (PubChem CID 89302132) has the molecular formula C25H26FN7O3S and a molecular weight of 523.59 g/mol. Its IUPAC name is 1-[(8aS)-7-[(2-amino-1,3-benzothiazol-4-yl)methyl]-3,6-dioxo-2,5,8,8a-tetrahydroimidazo[1,2-a]pyrazin-1-yl]-3-[(4-fluorophenyl)methyl]-1-prop-2-enylurea.
| Compound Name | 1-[(8aS)-7-[(2-amino-1,3-benzothiazol-4-yl)methyl]-3,6-dioxo-2,5,8,8a-tetrahydroimidazo[1,2-a]pyrazin-1-yl]-3-[(4-fluorophenyl)methyl]-1-prop-2-enylurea |
|---|---|
| PubChem CID | 89302132 |
| Molecular Formula | C25H26FN7O3S |
| Molecular Weight | 523.59 g/mol |
| Exact Mass | 523.18 |
| IUPAC Name | 1-[(8aS)-7-[(2-amino-1,3-benzothiazol-4-yl)methyl]-3,6-dioxo-2,5,8,8a-tetrahydroimidazo[1,2-a]pyrazin-1-yl]-3-[(4-fluorophenyl)methyl]-1-prop-2-enylurea |
| SMILES | C=CCN(C(=O)NCc1ccc(F)cc1)N1CC(=O)N2CC(=O)N(Cc3cccc4sc(N)nc34)C[C@@H]21 |
| InChI | InChI=1S/C25H26FN7O3S/c1-2-10-32(25(36)28-11-16-6-8-18(26)9-7-16)33-15-22(35)31-14-21(34)30(13-20(31)33)12-17-4-3-5-19-23(17)29-24(27)37-19/h2-9,20H,1,10-15H2,(H2,27,29)(H,28,36)/t20-/m0/s1 |
| InChIKey | RHXCWONTQARHHK-FQEVSTJZSA-N |
| XLogP | 2.14 |
| TPSA | 115.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.59 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|