C19H25N7O3S — CID 89168655
1-[(8aS)-7-[(2-amino-1,3-benzothiazol-4-yl)methyl]-3,6-dioxo-2,5,8,8a-tetrahydroimidazo[1,2-a]pyrazin-1-yl]-3-methyl-1-propylurea (PubChem CID 89168655) has the molecular formula C19H25N7O3S and a molecular weight of 431.52 g/mol. Its IUPAC name is 1-[(8aS)-7-[(2-amino-1,3-benzothiazol-4-yl)methyl]-3,6-dioxo-2,5,8,8a-tetrahydroimidazo[1,2-a]pyrazin-1-yl]-3-methyl-1-propylurea.
| Compound Name | 1-[(8aS)-7-[(2-amino-1,3-benzothiazol-4-yl)methyl]-3,6-dioxo-2,5,8,8a-tetrahydroimidazo[1,2-a]pyrazin-1-yl]-3-methyl-1-propylurea |
|---|---|
| PubChem CID | 89168655 |
| Molecular Formula | C19H25N7O3S |
| Molecular Weight | 431.52 g/mol |
| Exact Mass | 431.17 |
| IUPAC Name | 1-[(8aS)-7-[(2-amino-1,3-benzothiazol-4-yl)methyl]-3,6-dioxo-2,5,8,8a-tetrahydroimidazo[1,2-a]pyrazin-1-yl]-3-methyl-1-propylurea |
| SMILES | CCCN(C(=O)NC)N1CC(=O)N2CC(=O)N(Cc3cccc4sc(N)nc34)C[C@@H]21 |
| InChI | InChI=1S/C19H25N7O3S/c1-3-7-25(19(29)21-2)26-11-16(28)24-10-15(27)23(9-14(24)26)8-12-5-4-6-13-17(12)22-18(20)30-13/h4-6,14H,3,7-11H2,1-2H3,(H2,20,22)(H,21,29)/t14-/m0/s1 |
| InChIKey | ZAWLHGBNJXVFFA-AWEZNQCLSA-N |
| XLogP | 0.66 |
| TPSA | 115.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.52 |
| LogP ≤ 5 | 0.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |