C32H32N8O4S — CID 89301220
1-[(5S,8aS)-7-[(2-amino-1,3-benzothiazol-4-yl)methyl]-5-[(3-amino-4-hydroxyphenyl)methyl]-3,6-dioxo-2,5,8,8a-tetrahydroimidazo[1,2-a]pyrazin-1-yl]-3-benzyl-1-prop-2-ynylurea (PubChem CID 89301220) has the molecular formula C32H32N8O4S and a molecular weight of 624.73 g/mol. Its IUPAC name is 1-[(5S,8aS)-7-[(2-amino-1,3-benzothiazol-4-yl)methyl]-5-[(3-amino-4-hydroxyphenyl)methyl]-3,6-dioxo-2,5,8,8a-tetrahydroimidazo[1,2-a]pyrazin-1-yl]-3-benzyl-1-prop-2-ynylurea.
| Compound Name | 1-[(5S,8aS)-7-[(2-amino-1,3-benzothiazol-4-yl)methyl]-5-[(3-amino-4-hydroxyphenyl)methyl]-3,6-dioxo-2,5,8,8a-tetrahydroimidazo[1,2-a]pyrazin-1-yl]-3-benzyl-1-prop-2-ynylurea |
|---|---|
| PubChem CID | 89301220 |
| Molecular Formula | C32H32N8O4S |
| Molecular Weight | 624.73 g/mol |
| Exact Mass | 624.23 |
| IUPAC Name | 1-[(5S,8aS)-7-[(2-amino-1,3-benzothiazol-4-yl)methyl]-5-[(3-amino-4-hydroxyphenyl)methyl]-3,6-dioxo-2,5,8,8a-tetrahydroimidazo[1,2-a]pyrazin-1-yl]-3-benzyl-1-prop-2-ynylurea |
| SMILES | C#CCN(C(=O)NCc1ccccc1)N1CC(=O)N2[C@@H](Cc3ccc(O)c(N)c3)C(=O)N(Cc3cccc4sc(N)nc34)C[C@@H]21 |
| InChI | InChI=1S/C32H32N8O4S/c1-2-13-38(32(44)35-16-20-7-4-3-5-8-20)39-19-28(42)40-24(15-21-11-12-25(41)23(33)14-21)30(43)37(18-27(39)40)17-22-9-6-10-26-29(22)36-31(34)45-26/h1,3-12,14,24,27,41H,13,15-19,33H2,(H2,34,36)(H,35,44)/t24-,27+/m0/s1 |
| InChIKey | WGFVWMNAERFXNM-RPLLCQBOSA-N |
| XLogP | 2.35 |
| TPSA | 161.36 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 45 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 624.73 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|