C27H32FN7O3S — CID 89168685
1-[(5S,8aS)-7-[(2-amino-1,3-benzothiazol-4-yl)methyl]-5-[(4-fluorophenyl)methyl]-3,6-dioxo-2,5,8,8a-tetrahydroimidazo[1,2-a]pyrazin-1-yl]-3-butyl-1-methylurea (PubChem CID 89168685) has the molecular formula C27H32FN7O3S and a molecular weight of 553.66 g/mol. Its IUPAC name is 1-[(5S,8aS)-7-[(2-amino-1,3-benzothiazol-4-yl)methyl]-5-[(4-fluorophenyl)methyl]-3,6-dioxo-2,5,8,8a-tetrahydroimidazo[1,2-a]pyrazin-1-yl]-3-butyl-1-methylurea.
| Compound Name | 1-[(5S,8aS)-7-[(2-amino-1,3-benzothiazol-4-yl)methyl]-5-[(4-fluorophenyl)methyl]-3,6-dioxo-2,5,8,8a-tetrahydroimidazo[1,2-a]pyrazin-1-yl]-3-butyl-1-methylurea |
|---|---|
| PubChem CID | 89168685 |
| Molecular Formula | C27H32FN7O3S |
| Molecular Weight | 553.66 g/mol |
| Exact Mass | 553.23 |
| IUPAC Name | 1-[(5S,8aS)-7-[(2-amino-1,3-benzothiazol-4-yl)methyl]-5-[(4-fluorophenyl)methyl]-3,6-dioxo-2,5,8,8a-tetrahydroimidazo[1,2-a]pyrazin-1-yl]-3-butyl-1-methylurea |
| SMILES | CCCCNC(=O)N(C)N1CC(=O)N2[C@@H](Cc3ccc(F)cc3)C(=O)N(Cc3cccc4sc(N)nc34)C[C@@H]21 |
| InChI | InChI=1S/C27H32FN7O3S/c1-3-4-12-30-27(38)32(2)34-16-23(36)35-20(13-17-8-10-19(28)11-9-17)25(37)33(15-22(34)35)14-18-6-5-7-21-24(18)31-26(29)39-21/h5-11,20,22H,3-4,12-16H2,1-2H3,(H2,29,31)(H,30,38)/t20-,22+/m0/s1 |
| InChIKey | FMFMLGZHCFYRCO-RBBKRZOGSA-N |
| XLogP | 2.80 |
| TPSA | 115.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 553.66 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|