C33H39N7O3 — CID 89301227
1-[(5S,8aS)-7-[[2-[amino(methyl)amino]-3-ethenylphenyl]methyl]-3,6-dioxo-5-phenyl-2,5,8,8a-tetrahydroimidazo[1,2-a]pyrazin-1-yl]-3-benzyl-1-propylurea (PubChem CID 89301227) has the molecular formula C33H39N7O3 and a molecular weight of 581.72 g/mol. Its IUPAC name is 1-[(5S,8aS)-7-[[2-[amino(methyl)amino]-3-ethenylphenyl]methyl]-3,6-dioxo-5-phenyl-2,5,8,8a-tetrahydroimidazo[1,2-a]pyrazin-1-yl]-3-benzyl-1-propylurea.
| Compound Name | 1-[(5S,8aS)-7-[[2-[amino(methyl)amino]-3-ethenylphenyl]methyl]-3,6-dioxo-5-phenyl-2,5,8,8a-tetrahydroimidazo[1,2-a]pyrazin-1-yl]-3-benzyl-1-propylurea |
|---|---|
| PubChem CID | 89301227 |
| Molecular Formula | C33H39N7O3 |
| Molecular Weight | 581.72 g/mol |
| Exact Mass | 581.31 |
| IUPAC Name | 1-[(5S,8aS)-7-[[2-[amino(methyl)amino]-3-ethenylphenyl]methyl]-3,6-dioxo-5-phenyl-2,5,8,8a-tetrahydroimidazo[1,2-a]pyrazin-1-yl]-3-benzyl-1-propylurea |
| SMILES | C=Cc1cccc(CN2C[C@H]3N(C(=O)CN3N(CCC)C(=O)NCc3ccccc3)[C@@H](c3ccccc3)C2=O)c1N(C)N |
| InChI | InChI=1S/C33H39N7O3/c1-4-19-38(33(43)35-20-24-13-8-6-9-14-24)39-23-29(41)40-28(39)22-37(32(42)31(40)26-15-10-7-11-16-26)21-27-18-12-17-25(5-2)30(27)36(3)34/h5-18,28,31H,2,4,19-23,34H2,1,3H3,(H,35,43)/t28-,31+/m1/s1 |
| InChIKey | UYNHMMQCKPRYCV-MVSFAKPFSA-N |
| XLogP | 3.73 |
| TPSA | 105.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 581.72 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|