C34H43N7O3 — CID 89168542
(5S,8aS)-7-[[2-[amino(methyl)amino]-3-ethenylphenyl]methyl]-1-[(benzylamino)methoxymethyl-propylamino]-5-phenyl-2,5,8,8a-tetrahydroimidazo[1,2-a]pyrazine-3,6-dione (PubChem CID 89168542) has the molecular formula C34H43N7O3 and a molecular weight of 597.76 g/mol. Its IUPAC name is (5S,8aS)-7-[[2-[amino(methyl)amino]-3-ethenylphenyl]methyl]-1-[(benzylamino)methoxymethyl-propylamino]-5-phenyl-2,5,8,8a-tetrahydroimidazo[1,2-a]pyrazine-3,6-dione.
| Compound Name | (5S,8aS)-7-[[2-[amino(methyl)amino]-3-ethenylphenyl]methyl]-1-[(benzylamino)methoxymethyl-propylamino]-5-phenyl-2,5,8,8a-tetrahydroimidazo[1,2-a]pyrazine-3,6-dione |
|---|---|
| PubChem CID | 89168542 |
| Molecular Formula | C34H43N7O3 |
| Molecular Weight | 597.76 g/mol |
| Exact Mass | 597.34 |
| IUPAC Name | (5S,8aS)-7-[[2-[amino(methyl)amino]-3-ethenylphenyl]methyl]-1-[(benzylamino)methoxymethyl-propylamino]-5-phenyl-2,5,8,8a-tetrahydroimidazo[1,2-a]pyrazine-3,6-dione |
| SMILES | C=Cc1cccc(CN2C[C@H]3N(C(=O)CN3N(CCC)COCNCc3ccccc3)[C@@H](c3ccccc3)C2=O)c1N(C)N |
| InChI | InChI=1S/C34H43N7O3/c1-4-19-39(25-44-24-36-20-26-13-8-6-9-14-26)40-23-31(42)41-30(40)22-38(34(43)33(41)28-15-10-7-11-16-28)21-29-18-12-17-27(5-2)32(29)37(3)35/h5-18,30,33,36H,2,4,19-25,35H2,1,3H3/t30-,33+/m1/s1 |
| InChIKey | GIWTUTPWVVQTLR-NDKRRWIDSA-N |
| XLogP | 3.54 |
| TPSA | 97.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 597.76 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|