C31H31N7O3 — CID 89302102
1-[(5S,8aS)-7-(1H-indazol-4-ylmethyl)-3,6-dioxo-5-phenyl-2,5,8,8a-tetrahydroimidazo[1,2-a]pyrazin-1-yl]-3-benzyl-1-prop-2-enylurea (PubChem CID 89302102) has the molecular formula C31H31N7O3 and a molecular weight of 549.64 g/mol. Its IUPAC name is 1-[(5S,8aS)-7-(1H-indazol-4-ylmethyl)-3,6-dioxo-5-phenyl-2,5,8,8a-tetrahydroimidazo[1,2-a]pyrazin-1-yl]-3-benzyl-1-prop-2-enylurea.
| Compound Name | 1-[(5S,8aS)-7-(1H-indazol-4-ylmethyl)-3,6-dioxo-5-phenyl-2,5,8,8a-tetrahydroimidazo[1,2-a]pyrazin-1-yl]-3-benzyl-1-prop-2-enylurea |
|---|---|
| PubChem CID | 89302102 |
| Molecular Formula | C31H31N7O3 |
| Molecular Weight | 549.64 g/mol |
| Exact Mass | 549.25 |
| IUPAC Name | 1-[(5S,8aS)-7-(1H-indazol-4-ylmethyl)-3,6-dioxo-5-phenyl-2,5,8,8a-tetrahydroimidazo[1,2-a]pyrazin-1-yl]-3-benzyl-1-prop-2-enylurea |
| SMILES | C=CCN(C(=O)NCc1ccccc1)N1CC(=O)N2[C@@H](c3ccccc3)C(=O)N(Cc3cccc4[nH]ncc34)C[C@@H]21 |
| InChI | InChI=1S/C31H31N7O3/c1-2-16-36(31(41)32-17-22-10-5-3-6-11-22)37-21-28(39)38-27(37)20-35(30(40)29(38)23-12-7-4-8-13-23)19-24-14-9-15-26-25(24)18-33-34-26/h2-15,18,27,29H,1,16-17,19-21H2,(H,32,41)(H,33,34)/t27-,29+/m1/s1 |
| InChIKey | BQVFNYAROFRFBK-PXJZQJOASA-N |
| XLogP | 3.43 |
| TPSA | 104.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 549.64 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|