C33H36N6O3 — CID 70993164
3-benzyl-1-[(5S)-5-cyclohexa-1,5-dien-1-yl-3,6-dioxo-7-(quinolin-4-ylmethyl)-2,5,8,8a-tetrahydroimidazo[1,2-a]pyrazin-1-yl]-1-propylurea (PubChem CID 70993164) has the molecular formula C33H36N6O3 and a molecular weight of 564.69 g/mol. Its IUPAC name is 3-benzyl-1-[(5S)-5-cyclohexa-1,5-dien-1-yl-3,6-dioxo-7-(quinolin-4-ylmethyl)-2,5,8,8a-tetrahydroimidazo[1,2-a]pyrazin-1-yl]-1-propylurea.
| Compound Name | 3-benzyl-1-[(5S)-5-cyclohexa-1,5-dien-1-yl-3,6-dioxo-7-(quinolin-4-ylmethyl)-2,5,8,8a-tetrahydroimidazo[1,2-a]pyrazin-1-yl]-1-propylurea |
|---|---|
| PubChem CID | 70993164 |
| Molecular Formula | C33H36N6O3 |
| Molecular Weight | 564.69 g/mol |
| Exact Mass | 564.28 |
| IUPAC Name | 3-benzyl-1-[(5S)-5-cyclohexa-1,5-dien-1-yl-3,6-dioxo-7-(quinolin-4-ylmethyl)-2,5,8,8a-tetrahydroimidazo[1,2-a]pyrazin-1-yl]-1-propylurea |
| SMILES | CCCN(C(=O)NCc1ccccc1)N1CC(=O)N2C1CN(Cc1ccnc3ccccc13)C(=O)[C@@H]2C1=CCCC=C1 |
| InChI | InChI=1S/C33H36N6O3/c1-2-19-37(33(42)35-20-24-11-5-3-6-12-24)38-23-30(40)39-29(38)22-36(32(41)31(39)25-13-7-4-8-14-25)21-26-17-18-34-28-16-10-9-15-27(26)28/h3,5-7,9-18,29,31H,2,4,8,19-23H2,1H3,(H,35,42)/t29?,31-/m0/s1 |
| InChIKey | COJWQCHRSGXQIK-RDFOUATCSA-N |
| XLogP | 4.23 |
| TPSA | 89.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 564.69 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |