C30H32FN5O3 — CID 89353776
3-benzyl-1-[(5S)-5-cyclohexa-1,5-dien-1-yl-7-[(3-fluorophenyl)methyl]-3,6-dioxo-2,5,8,8a-tetrahydroimidazo[1,2-a]pyrazin-1-yl]-1-prop-2-enylurea (PubChem CID 89353776) has the molecular formula C30H32FN5O3 and a molecular weight of 529.62 g/mol. Its IUPAC name is 3-benzyl-1-[(5S)-5-cyclohexa-1,5-dien-1-yl-7-[(3-fluorophenyl)methyl]-3,6-dioxo-2,5,8,8a-tetrahydroimidazo[1,2-a]pyrazin-1-yl]-1-prop-2-enylurea.
| Compound Name | 3-benzyl-1-[(5S)-5-cyclohexa-1,5-dien-1-yl-7-[(3-fluorophenyl)methyl]-3,6-dioxo-2,5,8,8a-tetrahydroimidazo[1,2-a]pyrazin-1-yl]-1-prop-2-enylurea |
|---|---|
| PubChem CID | 89353776 |
| Molecular Formula | C30H32FN5O3 |
| Molecular Weight | 529.62 g/mol |
| Exact Mass | 529.25 |
| IUPAC Name | 3-benzyl-1-[(5S)-5-cyclohexa-1,5-dien-1-yl-7-[(3-fluorophenyl)methyl]-3,6-dioxo-2,5,8,8a-tetrahydroimidazo[1,2-a]pyrazin-1-yl]-1-prop-2-enylurea |
| SMILES | C=CCN(C(=O)NCc1ccccc1)N1CC(=O)N2C1CN(Cc1cccc(F)c1)C(=O)[C@@H]2C1=CCCC=C1 |
| InChI | InChI=1S/C30H32FN5O3/c1-2-16-34(30(39)32-18-22-10-5-3-6-11-22)35-21-27(37)36-26(35)20-33(19-23-12-9-15-25(31)17-23)29(38)28(36)24-13-7-4-8-14-24/h2-3,5-7,9-15,17,26,28H,1,4,8,16,18-21H2,(H,32,39)/t26?,28-/m0/s1 |
| InChIKey | HKLLLVBQJBXGLN-RXBHZZDJSA-N |
| XLogP | 3.60 |
| TPSA | 76.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.62 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|