C32H35N7O7S — CID 59204610
[4-[[(6S,9aS)-1-(benzylcarbamoyl)-8-[(3-carbamoylphenyl)methyl]-4,7-dioxo-2-prop-2-enyl-3,6,9,9a-tetrahydropyrazino[2,1-c][1,2,4]triazin-6-yl]methyl]phenyl] sulfamate (PubChem CID 59204610) has the molecular formula C32H35N7O7S and a molecular weight of 661.74 g/mol. Its IUPAC name is [4-[[(6S,9aS)-1-(benzylcarbamoyl)-8-[(3-carbamoylphenyl)methyl]-4,7-dioxo-2-prop-2-enyl-3,6,9,9a-tetrahydropyrazino[2,1-c][1,2,4]triazin-6-yl]methyl]phenyl] sulfamate.
| Compound Name | [4-[[(6S,9aS)-1-(benzylcarbamoyl)-8-[(3-carbamoylphenyl)methyl]-4,7-dioxo-2-prop-2-enyl-3,6,9,9a-tetrahydropyrazino[2,1-c][1,2,4]triazin-6-yl]methyl]phenyl] sulfamate |
|---|---|
| PubChem CID | 59204610 |
| Molecular Formula | C32H35N7O7S |
| Molecular Weight | 661.74 g/mol |
| Exact Mass | 661.23 |
| IUPAC Name | [4-[[(6S,9aS)-1-(benzylcarbamoyl)-8-[(3-carbamoylphenyl)methyl]-4,7-dioxo-2-prop-2-enyl-3,6,9,9a-tetrahydropyrazino[2,1-c][1,2,4]triazin-6-yl]methyl]phenyl] sulfamate |
| SMILES | C=CCN1CC(=O)N2[C@@H](Cc3ccc(OS(N)(=O)=O)cc3)C(=O)N(Cc3cccc(C(N)=O)c3)C[C@@H]2N1C(=O)NCc1ccccc1 |
| InChI | InChI=1S/C32H35N7O7S/c1-2-15-37-21-29(40)38-27(17-22-11-13-26(14-12-22)46-47(34,44)45)31(42)36(19-24-9-6-10-25(16-24)30(33)41)20-28(38)39(37)32(43)35-18-23-7-4-3-5-8-23/h2-14,16,27-28H,1,15,17-21H2,(H2,33,41)(H,35,43)(H2,34,44,45)/t27-,28-/m0/s1 |
| InChIKey | OJPXKGPACDRFLS-NSOVKSMOSA-N |
| XLogP | 1.10 |
| TPSA | 188.68 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 47 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 661.74 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|