C22H24FN5O3 — CID 143145439
(9aS)-N-benzyl-8-[(3-fluorophenyl)methyl]-2-methyl-4,7-dioxo-3,6,9,9a-tetrahydropyrazino[2,1-c][1,2,4]triazine-1-carboxamide (PubChem CID 143145439) has the molecular formula C22H24FN5O3 and a molecular weight of 425.46 g/mol. Its IUPAC name is (9aS)-N-benzyl-8-[(3-fluorophenyl)methyl]-2-methyl-4,7-dioxo-3,6,9,9a-tetrahydropyrazino[2,1-c][1,2,4]triazine-1-carboxamide.
| Compound Name | (9aS)-N-benzyl-8-[(3-fluorophenyl)methyl]-2-methyl-4,7-dioxo-3,6,9,9a-tetrahydropyrazino[2,1-c][1,2,4]triazine-1-carboxamide |
|---|---|
| PubChem CID | 143145439 |
| Molecular Formula | C22H24FN5O3 |
| Molecular Weight | 425.46 g/mol |
| Exact Mass | 425.19 |
| IUPAC Name | (9aS)-N-benzyl-8-[(3-fluorophenyl)methyl]-2-methyl-4,7-dioxo-3,6,9,9a-tetrahydropyrazino[2,1-c][1,2,4]triazine-1-carboxamide |
| SMILES | CN1CC(=O)N2CC(=O)N(Cc3cccc(F)c3)C[C@@H]2N1C(=O)NCc1ccccc1 |
| InChI | InChI=1S/C22H24FN5O3/c1-25-14-21(30)27-15-20(29)26(12-17-8-5-9-18(23)10-17)13-19(27)28(25)22(31)24-11-16-6-3-2-4-7-16/h2-10,19H,11-15H2,1H3,(H,24,31)/t19-/m0/s1 |
| InChIKey | DNSFJFYKGWYJNK-IBGZPJMESA-N |
| XLogP | 1.39 |
| TPSA | 76.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.46 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |