C29H30ClN5O3 — CID 142956777
(6S)-N,6-dibenzyl-8-[(3-chlorophenyl)methyl]-2-methyl-4,7-dioxo-3,6,9,9a-tetrahydropyrazino[2,1-c][1,2,4]triazine-1-carboxamide (PubChem CID 142956777) has the molecular formula C29H30ClN5O3 and a molecular weight of 532.04 g/mol. Its IUPAC name is (6S)-N,6-dibenzyl-8-[(3-chlorophenyl)methyl]-2-methyl-4,7-dioxo-3,6,9,9a-tetrahydropyrazino[2,1-c][1,2,4]triazine-1-carboxamide.
| Compound Name | (6S)-N,6-dibenzyl-8-[(3-chlorophenyl)methyl]-2-methyl-4,7-dioxo-3,6,9,9a-tetrahydropyrazino[2,1-c][1,2,4]triazine-1-carboxamide |
|---|---|
| PubChem CID | 142956777 |
| Molecular Formula | C29H30ClN5O3 |
| Molecular Weight | 532.04 g/mol |
| Exact Mass | 531.20 |
| IUPAC Name | (6S)-N,6-dibenzyl-8-[(3-chlorophenyl)methyl]-2-methyl-4,7-dioxo-3,6,9,9a-tetrahydropyrazino[2,1-c][1,2,4]triazine-1-carboxamide |
| SMILES | CN1CC(=O)N2C(CN(Cc3cccc(Cl)c3)C(=O)[C@@H]2Cc2ccccc2)N1C(=O)NCc1ccccc1 |
| InChI | InChI=1S/C29H30ClN5O3/c1-32-20-27(36)34-25(16-21-9-4-2-5-10-21)28(37)33(18-23-13-8-14-24(30)15-23)19-26(34)35(32)29(38)31-17-22-11-6-3-7-12-22/h2-15,25-26H,16-20H2,1H3,(H,31,38)/t25-,26?/m0/s1 |
| InChIKey | DLNQIQLDUNWOOF-PMCHYTPCSA-N |
| XLogP | 3.52 |
| TPSA | 76.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.04 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |