C25H30BN5O3S — CID 88871118
CID 88871118 (PubChem CID 88871118) has the molecular formula C25H30BN5O3S and a molecular weight of 491.43 g/mol.
| Compound Name | CID 88871118 |
|---|---|
| PubChem CID | 88871118 |
| Molecular Formula | C25H30BN5O3S |
| Molecular Weight | 491.43 g/mol |
| Exact Mass | 491.22 |
| IUPAC Name | — |
| SMILES | [B]c1cccc(CN2C[C@H]3N(C(=O)CN(C)N3C(=O)NCc3ccccc3)[C@@H](CCSC)C2=O)c1 |
| InChI | InChI=1S/C25H30BN5O3S/c1-28-17-23(32)30-21(11-12-35-2)24(33)29(15-19-9-6-10-20(26)13-19)16-22(30)31(28)25(34)27-14-18-7-4-3-5-8-18/h3-10,13,21-22H,11-12,14-17H2,1-2H3,(H,27,34)/t21-,22-/m0/s1 |
| InChIKey | FUIPFFRAIFIPDM-VXKWHMMOSA-N |
| XLogP | 1.17 |
| TPSA | 76.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.43 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|