C28H31N5O3S — CID 66787739
N-benzyl-2-methyl-6-(2-methylsulfanylethyl)-8-naphthalen-2-yl-4,7-dioxo-3,6,9,9a-tetrahydropyrazino[2,1-c][1,2,4]triazine-1-carboxamide (PubChem CID 66787739) has the molecular formula C28H31N5O3S and a molecular weight of 517.66 g/mol. Its IUPAC name is N-benzyl-2-methyl-6-(2-methylsulfanylethyl)-8-naphthalen-2-yl-4,7-dioxo-3,6,9,9a-tetrahydropyrazino[2,1-c][1,2,4]triazine-1-carboxamide.
| Compound Name | N-benzyl-2-methyl-6-(2-methylsulfanylethyl)-8-naphthalen-2-yl-4,7-dioxo-3,6,9,9a-tetrahydropyrazino[2,1-c][1,2,4]triazine-1-carboxamide |
|---|---|
| PubChem CID | 66787739 |
| Molecular Formula | C28H31N5O3S |
| Molecular Weight | 517.66 g/mol |
| Exact Mass | 517.21 |
| IUPAC Name | N-benzyl-2-methyl-6-(2-methylsulfanylethyl)-8-naphthalen-2-yl-4,7-dioxo-3,6,9,9a-tetrahydropyrazino[2,1-c][1,2,4]triazine-1-carboxamide |
| SMILES | CSCCC1C(=O)N(c2ccc3ccccc3c2)CC2N1C(=O)CN(C)N2C(=O)NCc1ccccc1 |
| InChI | InChI=1S/C28H31N5O3S/c1-30-19-26(34)32-24(14-15-37-2)27(35)31(23-13-12-21-10-6-7-11-22(21)16-23)18-25(32)33(30)28(36)29-17-20-8-4-3-5-9-20/h3-13,16,24-25H,14-15,17-19H2,1-2H3,(H,29,36) |
| InChIKey | APLVYWZRRHUDNI-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 76.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.66 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |