C34H39N5O3S — CID 143145582
(3S,9S,10E,12Z,14Z,16E)-N-benzyl-5-methyl-9-(2-methylsulfanylethyl)-7-oxo-16-(2-oxoethylidene)-17-phenyl-1,4,5,8-tetrazatricyclo[8.8.0.03,8]octadeca-10,12,14-triene-4-carboxamide (PubChem CID 143145582) has the molecular formula C34H39N5O3S and a molecular weight of 597.79 g/mol. Its IUPAC name is (3S,9S,10E,12Z,14Z,16E)-N-benzyl-5-methyl-9-(2-methylsulfanylethyl)-7-oxo-16-(2-oxoethylidene)-17-phenyl-1,4,5,8-tetrazatricyclo[8.8.0.03,8]octadeca-10,12,14-triene-4-carboxamide.
| Compound Name | (3S,9S,10E,12Z,14Z,16E)-N-benzyl-5-methyl-9-(2-methylsulfanylethyl)-7-oxo-16-(2-oxoethylidene)-17-phenyl-1,4,5,8-tetrazatricyclo[8.8.0.03,8]octadeca-10,12,14-triene-4-carboxamide |
|---|---|
| PubChem CID | 143145582 |
| Molecular Formula | C34H39N5O3S |
| Molecular Weight | 597.79 g/mol |
| Exact Mass | 597.28 |
| IUPAC Name | (3S,9S,10E,12Z,14Z,16E)-N-benzyl-5-methyl-9-(2-methylsulfanylethyl)-7-oxo-16-(2-oxoethylidene)-17-phenyl-1,4,5,8-tetrazatricyclo[8.8.0.03,8]octadeca-10,12,14-triene-4-carboxamide |
| SMILES | CSCC[C@H]1/C2=C\C=C/C=C\C(=C/C=O)C(c3ccccc3)CN2C[C@H]2N1C(=O)CN(C)N2C(=O)NCc1ccccc1 |
| InChI | InChI=1S/C34H39N5O3S/c1-36-25-33(41)38-31(19-21-43-2)30-17-11-5-10-16-28(18-20-40)29(27-14-8-4-9-15-27)23-37(30)24-32(38)39(36)34(42)35-22-26-12-6-3-7-13-26/h3-18,20,29,31-32H,19,21-25H2,1-2H3,(H,35,42)/b11-5-,16-10-,28-18+,30-17+/t29?,31-,32-/m0/s1 |
| InChIKey | POQYQWQYEWVZMW-ZHZJRYPRSA-N |
| XLogP | 4.57 |
| TPSA | 76.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 597.79 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|