C26H30F3N5O3 — CID 11699241
(6S,9aS)-N-benzyl-2-methyl-4,7-dioxo-6-propan-2-yl-8-[[3-(trifluoromethyl)phenyl]methyl]-3,6,9,9a-tetrahydropyrazino[2,1-c][1,2,4]triazine-1-carboxamide (PubChem CID 11699241) has the molecular formula C26H30F3N5O3 and a molecular weight of 517.55 g/mol. Its IUPAC name is (6S,9aS)-N-benzyl-2-methyl-4,7-dioxo-6-propan-2-yl-8-[[3-(trifluoromethyl)phenyl]methyl]-3,6,9,9a-tetrahydropyrazino[2,1-c][1,2,4]triazine-1-carboxamide.
| Compound Name | (6S,9aS)-N-benzyl-2-methyl-4,7-dioxo-6-propan-2-yl-8-[[3-(trifluoromethyl)phenyl]methyl]-3,6,9,9a-tetrahydropyrazino[2,1-c][1,2,4]triazine-1-carboxamide |
|---|---|
| PubChem CID | 11699241 |
| Molecular Formula | C26H30F3N5O3 |
| Molecular Weight | 517.55 g/mol |
| Exact Mass | 517.23 |
| IUPAC Name | (6S,9aS)-N-benzyl-2-methyl-4,7-dioxo-6-propan-2-yl-8-[[3-(trifluoromethyl)phenyl]methyl]-3,6,9,9a-tetrahydropyrazino[2,1-c][1,2,4]triazine-1-carboxamide |
| SMILES | CC(C)[C@H]1C(=O)N(Cc2cccc(C(F)(F)F)c2)C[C@H]2N1C(=O)CN(C)N2C(=O)NCc1ccccc1 |
| InChI | InChI=1S/C26H30F3N5O3/c1-17(2)23-24(36)32(14-19-10-7-11-20(12-19)26(27,28)29)15-21-33(23)22(35)16-31(3)34(21)25(37)30-13-18-8-5-4-6-9-18/h4-12,17,21,23H,13-16H2,1-3H3,(H,30,37)/t21-,23-/m0/s1 |
| InChIKey | SUFNYFORRCYJHQ-GMAHTHKFSA-N |
| XLogP | 3.30 |
| TPSA | 76.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.55 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |