C26H32F3N5O3 — CID 143145171
butane;8-[(2,4-difluorophenyl)methyl]-N-[(4-fluorophenyl)methyl]-2-methyl-4,7-dioxo-3,6,9,9a-tetrahydropyrazino[2,1-c][1,2,4]triazine-1-carboxamide (PubChem CID 143145171) has the molecular formula C26H32F3N5O3 and a molecular weight of 519.57 g/mol. Its IUPAC name is butane;8-[(2,4-difluorophenyl)methyl]-N-[(4-fluorophenyl)methyl]-2-methyl-4,7-dioxo-3,6,9,9a-tetrahydropyrazino[2,1-c][1,2,4]triazine-1-carboxamide.
| Compound Name | butane;8-[(2,4-difluorophenyl)methyl]-N-[(4-fluorophenyl)methyl]-2-methyl-4,7-dioxo-3,6,9,9a-tetrahydropyrazino[2,1-c][1,2,4]triazine-1-carboxamide |
|---|---|
| PubChem CID | 143145171 |
| Molecular Formula | C26H32F3N5O3 |
| Molecular Weight | 519.57 g/mol |
| Exact Mass | 519.25 |
| IUPAC Name | butane;8-[(2,4-difluorophenyl)methyl]-N-[(4-fluorophenyl)methyl]-2-methyl-4,7-dioxo-3,6,9,9a-tetrahydropyrazino[2,1-c][1,2,4]triazine-1-carboxamide |
| SMILES | CCCC.CN1CC(=O)N2CC(=O)N(Cc3ccc(F)cc3F)CC2N1C(=O)NCc1ccc(F)cc1 |
| InChI | InChI=1S/C22H22F3N5O3.C4H10/c1-27-12-21(32)29-13-20(31)28(10-15-4-7-17(24)8-18(15)25)11-19(29)30(27)22(33)26-9-14-2-5-16(23)6-3-14;1-3-4-2/h2-8,19H,9-13H2,1H3,(H,26,33);3-4H2,1-2H3 |
| InChIKey | OBBDPCPCBBLKDH-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 76.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.57 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |