C16H18F2N4O3 — CID 142956686
1-acetyl-8-[(2,4-difluorophenyl)methyl]-2-methyl-3,6,9,9a-tetrahydropyrazino[2,1-c][1,2,4]triazine-4,7-dione (PubChem CID 142956686) has the molecular formula C16H18F2N4O3 and a molecular weight of 352.34 g/mol. Its IUPAC name is 1-acetyl-8-[(2,4-difluorophenyl)methyl]-2-methyl-3,6,9,9a-tetrahydropyrazino[2,1-c][1,2,4]triazine-4,7-dione.
| Compound Name | 1-acetyl-8-[(2,4-difluorophenyl)methyl]-2-methyl-3,6,9,9a-tetrahydropyrazino[2,1-c][1,2,4]triazine-4,7-dione |
|---|---|
| PubChem CID | 142956686 |
| Molecular Formula | C16H18F2N4O3 |
| Molecular Weight | 352.34 g/mol |
| Exact Mass | 352.13 |
| IUPAC Name | 1-acetyl-8-[(2,4-difluorophenyl)methyl]-2-methyl-3,6,9,9a-tetrahydropyrazino[2,1-c][1,2,4]triazine-4,7-dione |
| SMILES | CC(=O)N1C2CN(Cc3ccc(F)cc3F)C(=O)CN2C(=O)CN1C |
| InChI | InChI=1S/C16H18F2N4O3/c1-10(23)22-14-7-20(6-11-3-4-12(17)5-13(11)18)15(24)9-21(14)16(25)8-19(22)2/h3-5,14H,6-9H2,1-2H3 |
| InChIKey | ZKSPVYPBXHLSAE-UHFFFAOYSA-N |
| XLogP | 0.17 |
| TPSA | 64.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.34 |
| LogP ≤ 5 | 0.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |