C31H35FN4O3 — CID 142956035
(6S)-1-acetyl-2-methyl-6-phenyl-8-(2-phenylethyl)-3,6,9,9a-tetrahydropyrazino[2,1-c][1,2,4]triazine-4,7-dione;1-ethyl-4-fluorobenzene (PubChem CID 142956035) has the molecular formula C31H35FN4O3 and a molecular weight of 530.64 g/mol. Its IUPAC name is (6S)-1-acetyl-2-methyl-6-phenyl-8-(2-phenylethyl)-3,6,9,9a-tetrahydropyrazino[2,1-c][1,2,4]triazine-4,7-dione;1-ethyl-4-fluorobenzene.
| Compound Name | (6S)-1-acetyl-2-methyl-6-phenyl-8-(2-phenylethyl)-3,6,9,9a-tetrahydropyrazino[2,1-c][1,2,4]triazine-4,7-dione;1-ethyl-4-fluorobenzene |
|---|---|
| PubChem CID | 142956035 |
| Molecular Formula | C31H35FN4O3 |
| Molecular Weight | 530.64 g/mol |
| Exact Mass | 530.27 |
| IUPAC Name | (6S)-1-acetyl-2-methyl-6-phenyl-8-(2-phenylethyl)-3,6,9,9a-tetrahydropyrazino[2,1-c][1,2,4]triazine-4,7-dione;1-ethyl-4-fluorobenzene |
| SMILES | CC(=O)N1C2CN(CCc3ccccc3)C(=O)[C@H](c3ccccc3)N2C(=O)CN1C.CCc1ccc(F)cc1 |
| InChI | InChI=1S/C23H26N4O3.C8H9F/c1-17(28)27-20-15-25(14-13-18-9-5-3-6-10-18)23(30)22(19-11-7-4-8-12-19)26(20)21(29)16-24(27)2;1-2-7-3-5-8(9)6-4-7/h3-12,20,22H,13-16H2,1-2H3;3-6H,2H2,1H3/t20?,22-;/m0./s1 |
| InChIKey | WACJJAFIRUUHHO-LCOAMIHASA-N |
| XLogP | 4.06 |
| TPSA | 64.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.64 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |