C20H19ClF2N2O2 — CID 154848686
4-(3-chloro-4-ethylbenzoyl)-1-[(2,4-difluorophenyl)methyl]piperazin-2-one (PubChem CID 154848686) has the molecular formula C20H19ClF2N2O2 and a molecular weight of 392.83 g/mol. Its IUPAC name is 4-(3-chloro-4-ethylbenzoyl)-1-[(2,4-difluorophenyl)methyl]piperazin-2-one.
| Compound Name | 4-(3-chloro-4-ethylbenzoyl)-1-[(2,4-difluorophenyl)methyl]piperazin-2-one |
|---|---|
| PubChem CID | 154848686 |
| Molecular Formula | C20H19ClF2N2O2 |
| Molecular Weight | 392.83 g/mol |
| Exact Mass | 392.11 |
| IUPAC Name | 4-(3-chloro-4-ethylbenzoyl)-1-[(2,4-difluorophenyl)methyl]piperazin-2-one |
| SMILES | CCc1ccc(C(=O)N2CCN(Cc3ccc(F)cc3F)C(=O)C2)cc1Cl |
| InChI | InChI=1S/C20H19ClF2N2O2/c1-2-13-3-4-14(9-17(13)21)20(27)25-8-7-24(19(26)12-25)11-15-5-6-16(22)10-18(15)23/h3-6,9-10H,2,7-8,11-12H2,1H3 |
| InChIKey | FZWQJTZTPDMCNJ-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.83 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |