About (3R)-3-bromo-1-[(2,4-difluorophenyl)methyl]piperidin-2-one
(3R)-3-bromo-1-[(2,4-difluorophenyl)methyl]piperidin-2-one (PubChem CID 95362471) has the molecular formula C12H12BrF2NO
and a molecular weight of 304.13 g/mol. Its IUPAC name is (3R)-3-bromo-1-[(2,4-difluorophenyl)methyl]piperidin-2-one.
Molecular Properties
| Compound Name | (3R)-3-bromo-1-[(2,4-difluorophenyl)methyl]piperidin-2-one |
| PubChem CID | 95362471 |
| Molecular Formula | C12H12BrF2NO |
| Molecular Weight | 304.13 g/mol |
| Exact Mass | 303.01 |
| IUPAC Name | (3R)-3-bromo-1-[(2,4-difluorophenyl)methyl]piperidin-2-one |
| SMILES | O=C1[C@H](Br)CCCN1Cc1ccc(F)cc1F |
| InChI | InChI=1S/C12H12BrF2NO/c13-10-2-1-5-16(12(10)17)7-8-3-4-9(14)6-11(8)15/h3-4,6,10H,1-2,5,7H2/t10-/m1/s1 |
| InChIKey | NJNXVDXLFSMGPK-SNVBAGLBSA-N |
| XLogP | 2.85 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 304.13 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze (3R)-3-bromo-1-[(2,4-difluorophenyl)methyl]piperidin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3R)-3-bromo-1-[(2,4-difluorophenyl)methyl]piperidin-2-one?
The IUPAC name of (3R)-3-bromo-1-[(2,4-difluorophenyl)methyl]piperidin-2-one (CID 95362471) is (3R)-3-bromo-1-[(2,4-difluorophenyl)methyl]piperidin-2-one.
What is the SMILES notation for (3R)-3-bromo-1-[(2,4-difluorophenyl)methyl]piperidin-2-one?
The canonical SMILES for (3R)-3-bromo-1-[(2,4-difluorophenyl)methyl]piperidin-2-one is O=C1[C@H](Br)CCCN1Cc1ccc(F)cc1F.
What is the InChIKey of (3R)-3-bromo-1-[(2,4-difluorophenyl)methyl]piperidin-2-one?
The InChIKey is NJNXVDXLFSMGPK-SNVBAGLBSA-N. The full InChI is InChI=1S/C12H12BrF2NO/c13-10-2-1-5-16(12(10)17)7-8-3-4-9(14)6-11(8)15/h3-4,6,10H,1-2,5,7H2/t10-/m1/s1.
What are the key properties of (3R)-3-bromo-1-[(2,4-difluorophenyl)methyl]piperidin-2-one?
(3R)-3-bromo-1-[(2,4-difluorophenyl)methyl]piperidin-2-one has a molecular weight of 304.13 g/mol, XLogP of 2.85, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (3R)-3-bromo-1-[(2,4-difluorophenyl)methyl]piperidin-2-one is sourced from PubChem (CID 95362471), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).