About (3R)-1-[(2,4-difluorophenyl)methyl]-3-pyridazin-3-ylsulfanylpiperidin-2-one
(3R)-1-[(2,4-difluorophenyl)methyl]-3-pyridazin-3-ylsulfanylpiperidin-2-one (PubChem CID 124887838) has the molecular formula C16H15F2N3OS
and a molecular weight of 335.38 g/mol. Its IUPAC name is (3R)-1-[(2,4-difluorophenyl)methyl]-3-pyridazin-3-ylsulfanylpiperidin-2-one.
Molecular Properties
| Compound Name | (3R)-1-[(2,4-difluorophenyl)methyl]-3-pyridazin-3-ylsulfanylpiperidin-2-one |
| PubChem CID | 124887838 |
| Molecular Formula | C16H15F2N3OS |
| Molecular Weight | 335.38 g/mol |
| Exact Mass | 335.09 |
| IUPAC Name | (3R)-1-[(2,4-difluorophenyl)methyl]-3-pyridazin-3-ylsulfanylpiperidin-2-one |
| SMILES | O=C1[C@H](Sc2cccnn2)CCCN1Cc1ccc(F)cc1F |
| InChI | InChI=1S/C16H15F2N3OS/c17-12-6-5-11(13(18)9-12)10-21-8-2-3-14(16(21)22)23-15-4-1-7-19-20-15/h1,4-7,9,14H,2-3,8,10H2/t14-/m1/s1 |
| InChIKey | FPBUWWQRJRAAIQ-CQSZACIVSA-N |
| XLogP | 3.04 |
| TPSA | 46.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 335.38 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze (3R)-1-[(2,4-difluorophenyl)methyl]-3-pyridazin-3-ylsulfanylpiperidin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3R)-1-[(2,4-difluorophenyl)methyl]-3-pyridazin-3-ylsulfanylpiperidin-2-one?
The IUPAC name of (3R)-1-[(2,4-difluorophenyl)methyl]-3-pyridazin-3-ylsulfanylpiperidin-2-one (CID 124887838) is (3R)-1-[(2,4-difluorophenyl)methyl]-3-pyridazin-3-ylsulfanylpiperidin-2-one.
What is the SMILES notation for (3R)-1-[(2,4-difluorophenyl)methyl]-3-pyridazin-3-ylsulfanylpiperidin-2-one?
The canonical SMILES for (3R)-1-[(2,4-difluorophenyl)methyl]-3-pyridazin-3-ylsulfanylpiperidin-2-one is O=C1[C@H](Sc2cccnn2)CCCN1Cc1ccc(F)cc1F.
What is the InChIKey of (3R)-1-[(2,4-difluorophenyl)methyl]-3-pyridazin-3-ylsulfanylpiperidin-2-one?
The InChIKey is FPBUWWQRJRAAIQ-CQSZACIVSA-N. The full InChI is InChI=1S/C16H15F2N3OS/c17-12-6-5-11(13(18)9-12)10-21-8-2-3-14(16(21)22)23-15-4-1-7-19-20-15/h1,4-7,9,14H,2-3,8,10H2/t14-/m1/s1.
What are the key properties of (3R)-1-[(2,4-difluorophenyl)methyl]-3-pyridazin-3-ylsulfanylpiperidin-2-one?
(3R)-1-[(2,4-difluorophenyl)methyl]-3-pyridazin-3-ylsulfanylpiperidin-2-one has a molecular weight of 335.38 g/mol, XLogP of 3.04, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (3R)-1-[(2,4-difluorophenyl)methyl]-3-pyridazin-3-ylsulfanylpiperidin-2-one is sourced from PubChem (CID 124887838), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).