About 5-[[(3R)-1-[(2,4-difluorophenyl)methyl]-2-oxopiperidin-3-yl]amino]pyridine-2-carbonitrile
5-[[(3R)-1-[(2,4-difluorophenyl)methyl]-2-oxopiperidin-3-yl]amino]pyridine-2-carbonitrile (PubChem CID 125138338) has the molecular formula C18H16F2N4O
and a molecular weight of 342.35 g/mol. Its IUPAC name is 5-[[(3R)-1-[(2,4-difluorophenyl)methyl]-2-oxopiperidin-3-yl]amino]pyridine-2-carbonitrile.
Molecular Properties
| Compound Name | 5-[[(3R)-1-[(2,4-difluorophenyl)methyl]-2-oxopiperidin-3-yl]amino]pyridine-2-carbonitrile |
| PubChem CID | 125138338 |
| Molecular Formula | C18H16F2N4O |
| Molecular Weight | 342.35 g/mol |
| Exact Mass | 342.13 |
| IUPAC Name | 5-[[(3R)-1-[(2,4-difluorophenyl)methyl]-2-oxopiperidin-3-yl]amino]pyridine-2-carbonitrile |
| SMILES | N#Cc1ccc(N[C@@H]2CCCN(Cc3ccc(F)cc3F)C2=O)cn1 |
| InChI | InChI=1S/C18H16F2N4O/c19-13-4-3-12(16(20)8-13)11-24-7-1-2-17(18(24)25)23-15-6-5-14(9-21)22-10-15/h3-6,8,10,17,23H,1-2,7,11H2/t17-/m1/s1 |
| InChIKey | PJDBZNALZDVEGL-QGZVFWFLSA-N |
| XLogP | 2.83 |
| TPSA | 69.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 342.35 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 5-[[(3R)-1-[(2,4-difluorophenyl)methyl]-2-oxopiperidin-3-yl]amino]pyridine-2-carbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-[[(3R)-1-[(2,4-difluorophenyl)methyl]-2-oxopiperidin-3-yl]amino]pyridine-2-carbonitrile?
The IUPAC name of 5-[[(3R)-1-[(2,4-difluorophenyl)methyl]-2-oxopiperidin-3-yl]amino]pyridine-2-carbonitrile (CID 125138338) is 5-[[(3R)-1-[(2,4-difluorophenyl)methyl]-2-oxopiperidin-3-yl]amino]pyridine-2-carbonitrile.
What is the SMILES notation for 5-[[(3R)-1-[(2,4-difluorophenyl)methyl]-2-oxopiperidin-3-yl]amino]pyridine-2-carbonitrile?
The canonical SMILES for 5-[[(3R)-1-[(2,4-difluorophenyl)methyl]-2-oxopiperidin-3-yl]amino]pyridine-2-carbonitrile is N#Cc1ccc(N[C@@H]2CCCN(Cc3ccc(F)cc3F)C2=O)cn1.
What is the InChIKey of 5-[[(3R)-1-[(2,4-difluorophenyl)methyl]-2-oxopiperidin-3-yl]amino]pyridine-2-carbonitrile?
The InChIKey is PJDBZNALZDVEGL-QGZVFWFLSA-N. The full InChI is InChI=1S/C18H16F2N4O/c19-13-4-3-12(16(20)8-13)11-24-7-1-2-17(18(24)25)23-15-6-5-14(9-21)22-10-15/h3-6,8,10,17,23H,1-2,7,11H2/t17-/m1/s1.
What are the key properties of 5-[[(3R)-1-[(2,4-difluorophenyl)methyl]-2-oxopiperidin-3-yl]amino]pyridine-2-carbonitrile?
5-[[(3R)-1-[(2,4-difluorophenyl)methyl]-2-oxopiperidin-3-yl]amino]pyridine-2-carbonitrile has a molecular weight of 342.35 g/mol, XLogP of 2.83, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[[(3R)-1-[(2,4-difluorophenyl)methyl]-2-oxopiperidin-3-yl]amino]pyridine-2-carbonitrile is sourced from PubChem (CID 125138338), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).