C31H34F2N6O3 — CID 58888407
(6S,9aS)-N-benzyl-8-[(2,4-difluorophenyl)methyl]-6-[[4-(dimethylamino)phenyl]methyl]-2-methyl-4,7-dioxo-3,6,9,9a-tetrahydropyrazino[2,1-c][1,2,4]triazine-1-carboxamide (PubChem CID 58888407) has the molecular formula C31H34F2N6O3 and a molecular weight of 576.65 g/mol. Its IUPAC name is (6S,9aS)-N-benzyl-8-[(2,4-difluorophenyl)methyl]-6-[[4-(dimethylamino)phenyl]methyl]-2-methyl-4,7-dioxo-3,6,9,9a-tetrahydropyrazino[2,1-c][1,2,4]triazine-1-carboxamide.
| Compound Name | (6S,9aS)-N-benzyl-8-[(2,4-difluorophenyl)methyl]-6-[[4-(dimethylamino)phenyl]methyl]-2-methyl-4,7-dioxo-3,6,9,9a-tetrahydropyrazino[2,1-c][1,2,4]triazine-1-carboxamide |
|---|---|
| PubChem CID | 58888407 |
| Molecular Formula | C31H34F2N6O3 |
| Molecular Weight | 576.65 g/mol |
| Exact Mass | 576.27 |
| IUPAC Name | (6S,9aS)-N-benzyl-8-[(2,4-difluorophenyl)methyl]-6-[[4-(dimethylamino)phenyl]methyl]-2-methyl-4,7-dioxo-3,6,9,9a-tetrahydropyrazino[2,1-c][1,2,4]triazine-1-carboxamide |
| SMILES | CN(C)c1ccc(C[C@H]2C(=O)N(Cc3ccc(F)cc3F)C[C@H]3N2C(=O)CN(C)N3C(=O)NCc2ccccc2)cc1 |
| InChI | InChI=1S/C31H34F2N6O3/c1-35(2)25-13-9-21(10-14-25)15-27-30(41)37(18-23-11-12-24(32)16-26(23)33)19-28-38(27)29(40)20-36(3)39(28)31(42)34-17-22-7-5-4-6-8-22/h4-14,16,27-28H,15,17-20H2,1-3H3,(H,34,42)/t27-,28-/m0/s1 |
| InChIKey | LYVIBOAIXOSMIG-NSOVKSMOSA-N |
| XLogP | 3.21 |
| TPSA | 79.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 576.65 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|