C24H27F2N5O4 — CID 89229266
[(6R,9aS)-1-(benzylcarbamoyl)-8-[(2,4-difluorophenyl)methyl]-2-methyl-4-oxo-6,7,9,9a-tetrahydro-3H-pyrazino[2,1-c][1,2,4]triazin-6-yl]methyl formate (PubChem CID 89229266) has the molecular formula C24H27F2N5O4 and a molecular weight of 487.51 g/mol. Its IUPAC name is [(6R,9aS)-1-(benzylcarbamoyl)-8-[(2,4-difluorophenyl)methyl]-2-methyl-4-oxo-6,7,9,9a-tetrahydro-3H-pyrazino[2,1-c][1,2,4]triazin-6-yl]methyl formate.
| Compound Name | [(6R,9aS)-1-(benzylcarbamoyl)-8-[(2,4-difluorophenyl)methyl]-2-methyl-4-oxo-6,7,9,9a-tetrahydro-3H-pyrazino[2,1-c][1,2,4]triazin-6-yl]methyl formate |
|---|---|
| PubChem CID | 89229266 |
| Molecular Formula | C24H27F2N5O4 |
| Molecular Weight | 487.51 g/mol |
| Exact Mass | 487.20 |
| IUPAC Name | [(6R,9aS)-1-(benzylcarbamoyl)-8-[(2,4-difluorophenyl)methyl]-2-methyl-4-oxo-6,7,9,9a-tetrahydro-3H-pyrazino[2,1-c][1,2,4]triazin-6-yl]methyl formate |
| SMILES | CN1CC(=O)N2[C@@H](COC=O)CN(Cc3ccc(F)cc3F)C[C@@H]2N1C(=O)NCc1ccccc1 |
| InChI | InChI=1S/C24H27F2N5O4/c1-28-14-23(33)30-20(15-35-16-32)12-29(11-18-7-8-19(25)9-21(18)26)13-22(30)31(28)24(34)27-10-17-5-3-2-4-6-17/h2-9,16,20,22H,10-15H2,1H3,(H,27,34)/t20-,22+/m1/s1 |
| InChIKey | AIEWQCBDORHYAD-IRLDBZIGSA-N |
| XLogP | 1.55 |
| TPSA | 85.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.51 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|