C24H28F2IN7O3 — CID 89386819
(6S,9aS)-N-benzyl-6-(2,2-diaminoethyl)-8-[(2,4-difluorophenyl)methyl]-2-(iodomethyl)-4,7-dioxo-3,6,9,9a-tetrahydropyrazino[2,1-c][1,2,4]triazine-1-carboxamide (PubChem CID 89386819) has the molecular formula C24H28F2IN7O3 and a molecular weight of 627.43 g/mol. Its IUPAC name is (6S,9aS)-N-benzyl-6-(2,2-diaminoethyl)-8-[(2,4-difluorophenyl)methyl]-2-(iodomethyl)-4,7-dioxo-3,6,9,9a-tetrahydropyrazino[2,1-c][1,2,4]triazine-1-carboxamide.
| Compound Name | (6S,9aS)-N-benzyl-6-(2,2-diaminoethyl)-8-[(2,4-difluorophenyl)methyl]-2-(iodomethyl)-4,7-dioxo-3,6,9,9a-tetrahydropyrazino[2,1-c][1,2,4]triazine-1-carboxamide |
|---|---|
| PubChem CID | 89386819 |
| Molecular Formula | C24H28F2IN7O3 |
| Molecular Weight | 627.43 g/mol |
| Exact Mass | 627.13 |
| IUPAC Name | (6S,9aS)-N-benzyl-6-(2,2-diaminoethyl)-8-[(2,4-difluorophenyl)methyl]-2-(iodomethyl)-4,7-dioxo-3,6,9,9a-tetrahydropyrazino[2,1-c][1,2,4]triazine-1-carboxamide |
| SMILES | NC(N)C[C@H]1C(=O)N(Cc2ccc(F)cc2F)C[C@H]2N1C(=O)CN(CI)N2C(=O)NCc1ccccc1 |
| InChI | InChI=1S/C24H28F2IN7O3/c25-17-7-6-16(18(26)8-17)11-31-12-21-33(19(23(31)36)9-20(28)29)22(35)13-32(14-27)34(21)24(37)30-10-15-4-2-1-3-5-15/h1-8,19-21H,9-14,28-29H2,(H,30,37)/t19-,21-/m0/s1 |
| InChIKey | ZPROBQOAAAEEKZ-FPOVZHCZSA-N |
| XLogP | 1.30 |
| TPSA | 128.24 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 627.43 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|