C29H30F3N5O3 — CID 71222313
(6S,9aS)-N-benzyl-8-[(2,4-difluorophenyl)methyl]-2-(fluoromethyl)-6-[(4-hydroxyphenyl)methyl]-4-oxo-6,7,9,9a-tetrahydro-3H-pyrazino[2,1-c][1,2,4]triazine-1-carboxamide (PubChem CID 71222313) has the molecular formula C29H30F3N5O3 and a molecular weight of 553.59 g/mol. Its IUPAC name is (6S,9aS)-N-benzyl-8-[(2,4-difluorophenyl)methyl]-2-(fluoromethyl)-6-[(4-hydroxyphenyl)methyl]-4-oxo-6,7,9,9a-tetrahydro-3H-pyrazino[2,1-c][1,2,4]triazine-1-carboxamide.
| Compound Name | (6S,9aS)-N-benzyl-8-[(2,4-difluorophenyl)methyl]-2-(fluoromethyl)-6-[(4-hydroxyphenyl)methyl]-4-oxo-6,7,9,9a-tetrahydro-3H-pyrazino[2,1-c][1,2,4]triazine-1-carboxamide |
|---|---|
| PubChem CID | 71222313 |
| Molecular Formula | C29H30F3N5O3 |
| Molecular Weight | 553.59 g/mol |
| Exact Mass | 553.23 |
| IUPAC Name | (6S,9aS)-N-benzyl-8-[(2,4-difluorophenyl)methyl]-2-(fluoromethyl)-6-[(4-hydroxyphenyl)methyl]-4-oxo-6,7,9,9a-tetrahydro-3H-pyrazino[2,1-c][1,2,4]triazine-1-carboxamide |
| SMILES | O=C1CN(CF)N(C(=O)NCc2ccccc2)[C@H]2CN(Cc3ccc(F)cc3F)C[C@H](Cc3ccc(O)cc3)N12 |
| InChI | InChI=1S/C29H30F3N5O3/c30-19-35-18-28(39)36-24(12-20-6-10-25(38)11-7-20)16-34(15-22-8-9-23(31)13-26(22)32)17-27(36)37(35)29(40)33-14-21-4-2-1-3-5-21/h1-11,13,24,27,38H,12,14-19H2,(H,33,40)/t24-,27-/m0/s1 |
| InChIKey | MBIDGOUNZJSFAW-IGKIAQTJSA-N |
| XLogP | 3.62 |
| TPSA | 79.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 553.59 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|