C32H33F2N5O4 — CID 143145109
(6S)-N-benzyl-8-[(2,4-difluorophenyl)methyl]-6-[(4-hydroxyphenyl)methyl]-9-methyl-4,7-dioxo-2-prop-2-enyl-3,6,9,9a-tetrahydropyrazino[2,1-c][1,2,4]triazine-1-carboxamide (PubChem CID 143145109) has the molecular formula C32H33F2N5O4 and a molecular weight of 589.64 g/mol. Its IUPAC name is (6S)-N-benzyl-8-[(2,4-difluorophenyl)methyl]-6-[(4-hydroxyphenyl)methyl]-9-methyl-4,7-dioxo-2-prop-2-enyl-3,6,9,9a-tetrahydropyrazino[2,1-c][1,2,4]triazine-1-carboxamide.
| Compound Name | (6S)-N-benzyl-8-[(2,4-difluorophenyl)methyl]-6-[(4-hydroxyphenyl)methyl]-9-methyl-4,7-dioxo-2-prop-2-enyl-3,6,9,9a-tetrahydropyrazino[2,1-c][1,2,4]triazine-1-carboxamide |
|---|---|
| PubChem CID | 143145109 |
| Molecular Formula | C32H33F2N5O4 |
| Molecular Weight | 589.64 g/mol |
| Exact Mass | 589.25 |
| IUPAC Name | (6S)-N-benzyl-8-[(2,4-difluorophenyl)methyl]-6-[(4-hydroxyphenyl)methyl]-9-methyl-4,7-dioxo-2-prop-2-enyl-3,6,9,9a-tetrahydropyrazino[2,1-c][1,2,4]triazine-1-carboxamide |
| SMILES | C=CCN1CC(=O)N2C(C(C)N(Cc3ccc(F)cc3F)C(=O)[C@@H]2Cc2ccc(O)cc2)N1C(=O)NCc1ccccc1 |
| InChI | InChI=1S/C32H33F2N5O4/c1-3-15-36-20-29(41)38-28(16-22-9-13-26(40)14-10-22)31(42)37(19-24-11-12-25(33)17-27(24)34)21(2)30(38)39(36)32(43)35-18-23-7-5-4-6-8-23/h3-14,17,21,28,30,40H,1,15-16,18-20H2,2H3,(H,35,43)/t21?,28-,30?/m0/s1 |
| InChIKey | HQVVKSIVIZNEBS-YDZQEPRFSA-N |
| XLogP | 3.80 |
| TPSA | 96.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 589.64 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|