C35H37N6O7P — CID 71532249
[4-[[1-(benzylcarbamoyl)-9-methyl-4,7-dioxo-2-prop-2-enyl-8-(quinolin-8-ylmethyl)-3,6,9,9a-tetrahydropyrazino[2,1-c][1,2,4]triazin-6-yl]methyl]phenyl] dihydrogen phosphate (PubChem CID 71532249) has the molecular formula C35H37N6O7P and a molecular weight of 684.69 g/mol. Its IUPAC name is [4-[[1-(benzylcarbamoyl)-9-methyl-4,7-dioxo-2-prop-2-enyl-8-(quinolin-8-ylmethyl)-3,6,9,9a-tetrahydropyrazino[2,1-c][1,2,4]triazin-6-yl]methyl]phenyl] dihydrogen phosphate.
| Compound Name | [4-[[1-(benzylcarbamoyl)-9-methyl-4,7-dioxo-2-prop-2-enyl-8-(quinolin-8-ylmethyl)-3,6,9,9a-tetrahydropyrazino[2,1-c][1,2,4]triazin-6-yl]methyl]phenyl] dihydrogen phosphate |
|---|---|
| PubChem CID | 71532249 |
| Molecular Formula | C35H37N6O7P |
| Molecular Weight | 684.69 g/mol |
| Exact Mass | 684.25 |
| IUPAC Name | [4-[[1-(benzylcarbamoyl)-9-methyl-4,7-dioxo-2-prop-2-enyl-8-(quinolin-8-ylmethyl)-3,6,9,9a-tetrahydropyrazino[2,1-c][1,2,4]triazin-6-yl]methyl]phenyl] dihydrogen phosphate |
| SMILES | C=CCN1CC(=O)N2C(Cc3ccc(OP(=O)(O)O)cc3)C(=O)N(Cc3cccc4cccnc34)C(C)C2N1C(=O)NCc1ccccc1 |
| InChI | InChI=1S/C35H37N6O7P/c1-3-19-38-23-31(42)40-30(20-25-14-16-29(17-15-25)48-49(45,46)47)34(43)39(22-28-12-7-11-27-13-8-18-36-32(27)28)24(2)33(40)41(38)35(44)37-21-26-9-5-4-6-10-26/h3-18,24,30,33H,1,19-23H2,2H3,(H,37,44)(H2,45,46,47) |
| InChIKey | XBEROEAQLVCMOB-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 155.85 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 49 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 684.69 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|