C38H41N4O6P — CID 160642429
methyl-[4-[[9-methyl-8-(naphthalen-1-ylmethyl)-4,7-dioxo-1-(3-phenylpropanoyl)-2-prop-2-enyl-3,6,9,9a-tetrahydropyrazino[2,1-c][1,2,4]triazin-6-yl]methyl]phenoxy]phosphinic acid (PubChem CID 160642429) has the molecular formula C38H41N4O6P and a molecular weight of 680.74 g/mol. Its IUPAC name is methyl-[4-[[9-methyl-8-(naphthalen-1-ylmethyl)-4,7-dioxo-1-(3-phenylpropanoyl)-2-prop-2-enyl-3,6,9,9a-tetrahydropyrazino[2,1-c][1,2,4]triazin-6-yl]methyl]phenoxy]phosphinic acid.
| Compound Name | methyl-[4-[[9-methyl-8-(naphthalen-1-ylmethyl)-4,7-dioxo-1-(3-phenylpropanoyl)-2-prop-2-enyl-3,6,9,9a-tetrahydropyrazino[2,1-c][1,2,4]triazin-6-yl]methyl]phenoxy]phosphinic acid |
|---|---|
| PubChem CID | 160642429 |
| Molecular Formula | C38H41N4O6P |
| Molecular Weight | 680.74 g/mol |
| Exact Mass | 680.28 |
| IUPAC Name | methyl-[4-[[9-methyl-8-(naphthalen-1-ylmethyl)-4,7-dioxo-1-(3-phenylpropanoyl)-2-prop-2-enyl-3,6,9,9a-tetrahydropyrazino[2,1-c][1,2,4]triazin-6-yl]methyl]phenoxy]phosphinic acid |
| SMILES | C=CCN1CC(=O)N2C(Cc3ccc(OP(C)(=O)O)cc3)C(=O)N(Cc3cccc4ccccc34)C(C)C2N1C(=O)CCc1ccccc1 |
| InChI | InChI=1S/C38H41N4O6P/c1-4-23-39-26-36(44)41-34(24-29-17-20-32(21-18-29)48-49(3,46)47)38(45)40(25-31-15-10-14-30-13-8-9-16-33(30)31)27(2)37(41)42(39)35(43)22-19-28-11-6-5-7-12-28/h4-18,20-21,27,34,37H,1,19,22-26H2,2-3H3,(H,46,47) |
| InChIKey | RJIVQNPFDYTGKZ-UHFFFAOYSA-N |
| XLogP | 5.41 |
| TPSA | 110.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 680.74 |
| LogP ≤ 5 | 5.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|