C28H30N5O7P — CID 58477631
[4-[[(6S,9aS)-1-acetyl-4,7-dioxo-2-prop-2-enyl-8-(quinolin-8-ylmethyl)-3,6,9,9a-tetrahydropyrazino[2,1-c][1,2,4]triazin-6-yl]methyl]phenyl] dihydrogen phosphate (PubChem CID 58477631) has the molecular formula C28H30N5O7P and a molecular weight of 579.55 g/mol. Its IUPAC name is [4-[[(6S,9aS)-1-acetyl-4,7-dioxo-2-prop-2-enyl-8-(quinolin-8-ylmethyl)-3,6,9,9a-tetrahydropyrazino[2,1-c][1,2,4]triazin-6-yl]methyl]phenyl] dihydrogen phosphate.
| Compound Name | [4-[[(6S,9aS)-1-acetyl-4,7-dioxo-2-prop-2-enyl-8-(quinolin-8-ylmethyl)-3,6,9,9a-tetrahydropyrazino[2,1-c][1,2,4]triazin-6-yl]methyl]phenyl] dihydrogen phosphate |
|---|---|
| PubChem CID | 58477631 |
| Molecular Formula | C28H30N5O7P |
| Molecular Weight | 579.55 g/mol |
| Exact Mass | 579.19 |
| IUPAC Name | [4-[[(6S,9aS)-1-acetyl-4,7-dioxo-2-prop-2-enyl-8-(quinolin-8-ylmethyl)-3,6,9,9a-tetrahydropyrazino[2,1-c][1,2,4]triazin-6-yl]methyl]phenyl] dihydrogen phosphate |
| SMILES | C=CCN1CC(=O)N2[C@@H](Cc3ccc(OP(=O)(O)O)cc3)C(=O)N(Cc3cccc4cccnc34)C[C@@H]2N1C(C)=O |
| InChI | InChI=1S/C28H30N5O7P/c1-3-14-31-18-26(35)32-24(15-20-9-11-23(12-10-20)40-41(37,38)39)28(36)30(17-25(32)33(31)19(2)34)16-22-7-4-6-21-8-5-13-29-27(21)22/h3-13,24-25H,1,14-18H2,2H3,(H2,37,38,39)/t24-,25-/m0/s1 |
| InChIKey | JOCQRSTWWGRWOI-DQEYMECFSA-N |
| XLogP | 2.08 |
| TPSA | 143.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 579.55 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|