C32H32N6O4 — CID 58477647
(9aR)-N-benzyl-6-[(4-hydroxyphenyl)methyl]-2-methyl-4,7-dioxo-8-(quinolin-8-ylmethyl)-3,6,9,9a-tetrahydropyrazino[2,1-c][1,2,4]triazine-1-carboxamide (PubChem CID 58477647) has the molecular formula C32H32N6O4 and a molecular weight of 564.65 g/mol. Its IUPAC name is (9aR)-N-benzyl-6-[(4-hydroxyphenyl)methyl]-2-methyl-4,7-dioxo-8-(quinolin-8-ylmethyl)-3,6,9,9a-tetrahydropyrazino[2,1-c][1,2,4]triazine-1-carboxamide.
| Compound Name | (9aR)-N-benzyl-6-[(4-hydroxyphenyl)methyl]-2-methyl-4,7-dioxo-8-(quinolin-8-ylmethyl)-3,6,9,9a-tetrahydropyrazino[2,1-c][1,2,4]triazine-1-carboxamide |
|---|---|
| PubChem CID | 58477647 |
| Molecular Formula | C32H32N6O4 |
| Molecular Weight | 564.65 g/mol |
| Exact Mass | 564.25 |
| IUPAC Name | (9aR)-N-benzyl-6-[(4-hydroxyphenyl)methyl]-2-methyl-4,7-dioxo-8-(quinolin-8-ylmethyl)-3,6,9,9a-tetrahydropyrazino[2,1-c][1,2,4]triazine-1-carboxamide |
| SMILES | CN1CC(=O)N2C(Cc3ccc(O)cc3)C(=O)N(Cc3cccc4cccnc34)C[C@H]2N1C(=O)NCc1ccccc1 |
| InChI | InChI=1S/C32H32N6O4/c1-35-21-29(40)37-27(17-22-12-14-26(39)15-13-22)31(41)36(19-25-10-5-9-24-11-6-16-33-30(24)25)20-28(37)38(35)32(42)34-18-23-7-3-2-4-8-23/h2-16,27-28,39H,17-21H2,1H3,(H,34,42)/t27?,28-/m1/s1 |
| InChIKey | KLKCSFVYPUUFOO-PLYLYKGUSA-N |
| XLogP | 3.12 |
| TPSA | 109.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 564.65 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |