C36H38N6O4 — CID 90101936
(6S,9S)-6-[(4-hydroxyphenyl)methyl]-9-methyl-4,7-dioxo-N-(2-phenylethyl)-2-prop-2-enyl-8-(quinolin-8-ylmethyl)-3,6,9,9a-tetrahydropyrazino[2,1-c][1,2,4]triazine-1-carboxamide (PubChem CID 90101936) has the molecular formula C36H38N6O4 and a molecular weight of 618.74 g/mol. Its IUPAC name is (6S,9S)-6-[(4-hydroxyphenyl)methyl]-9-methyl-4,7-dioxo-N-(2-phenylethyl)-2-prop-2-enyl-8-(quinolin-8-ylmethyl)-3,6,9,9a-tetrahydropyrazino[2,1-c][1,2,4]triazine-1-carboxamide.
| Compound Name | (6S,9S)-6-[(4-hydroxyphenyl)methyl]-9-methyl-4,7-dioxo-N-(2-phenylethyl)-2-prop-2-enyl-8-(quinolin-8-ylmethyl)-3,6,9,9a-tetrahydropyrazino[2,1-c][1,2,4]triazine-1-carboxamide |
|---|---|
| PubChem CID | 90101936 |
| Molecular Formula | C36H38N6O4 |
| Molecular Weight | 618.74 g/mol |
| Exact Mass | 618.30 |
| IUPAC Name | (6S,9S)-6-[(4-hydroxyphenyl)methyl]-9-methyl-4,7-dioxo-N-(2-phenylethyl)-2-prop-2-enyl-8-(quinolin-8-ylmethyl)-3,6,9,9a-tetrahydropyrazino[2,1-c][1,2,4]triazine-1-carboxamide |
| SMILES | C=CCN1CC(=O)N2C([C@H](C)N(Cc3cccc4cccnc34)C(=O)[C@@H]2Cc2ccc(O)cc2)N1C(=O)NCCc1ccccc1 |
| InChI | InChI=1S/C36H38N6O4/c1-3-21-39-24-32(44)41-31(22-27-14-16-30(43)17-15-27)35(45)40(23-29-12-7-11-28-13-8-19-37-33(28)29)25(2)34(41)42(39)36(46)38-20-18-26-9-5-4-6-10-26/h3-17,19,25,31,34,43H,1,18,20-24H2,2H3,(H,38,46)/t25-,31-,34?/m0/s1 |
| InChIKey | IPTSTXLUCGSWRG-PUEMZFIESA-N |
| XLogP | 4.11 |
| TPSA | 109.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 46 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 618.74 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|