C27H30N6O3 — CID 175155418
(6S,9S)-N-benzyl-2,6,9-trimethyl-4,7-dioxo-8-(quinolin-8-ylmethyl)-3,6,9,9a-tetrahydropyrazino[2,1-c][1,2,4]triazine-1-carboxamide (PubChem CID 175155418) has the molecular formula C27H30N6O3 and a molecular weight of 486.58 g/mol. Its IUPAC name is (6S,9S)-N-benzyl-2,6,9-trimethyl-4,7-dioxo-8-(quinolin-8-ylmethyl)-3,6,9,9a-tetrahydropyrazino[2,1-c][1,2,4]triazine-1-carboxamide.
| Compound Name | (6S,9S)-N-benzyl-2,6,9-trimethyl-4,7-dioxo-8-(quinolin-8-ylmethyl)-3,6,9,9a-tetrahydropyrazino[2,1-c][1,2,4]triazine-1-carboxamide |
|---|---|
| PubChem CID | 175155418 |
| Molecular Formula | C27H30N6O3 |
| Molecular Weight | 486.58 g/mol |
| Exact Mass | 486.24 |
| IUPAC Name | (6S,9S)-N-benzyl-2,6,9-trimethyl-4,7-dioxo-8-(quinolin-8-ylmethyl)-3,6,9,9a-tetrahydropyrazino[2,1-c][1,2,4]triazine-1-carboxamide |
| SMILES | C[C@H]1C2N(C(=O)CN(C)N2C(=O)NCc2ccccc2)[C@@H](C)C(=O)N1Cc1cccc2cccnc12 |
| InChI | InChI=1S/C27H30N6O3/c1-18-25-32(23(34)17-30(3)33(25)27(36)29-15-20-9-5-4-6-10-20)19(2)26(35)31(18)16-22-12-7-11-21-13-8-14-28-24(21)22/h4-14,18-19,25H,15-17H2,1-3H3,(H,29,36)/t18-,19-,25?/m0/s1 |
| InChIKey | QYJMYHAIASBMKA-NHDFCTKWSA-N |
| XLogP | 2.58 |
| TPSA | 89.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.58 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |