C34H36N5O7P — CID 90347921
[4-[[(6S,9S,9aS)-1-(benzylcarbamoyl)-2,9-dimethyl-8-(naphthalen-1-ylmethyl)-4,7-dioxo-3,6,9,9a-tetrahydropyrazino[2,1-c][1,2,4]triazin-6-yl]methyl]phenyl] dihydrogen phosphate (PubChem CID 90347921) has the molecular formula C34H36N5O7P and a molecular weight of 657.66 g/mol. Its IUPAC name is [4-[[(6S,9S,9aS)-1-(benzylcarbamoyl)-2,9-dimethyl-8-(naphthalen-1-ylmethyl)-4,7-dioxo-3,6,9,9a-tetrahydropyrazino[2,1-c][1,2,4]triazin-6-yl]methyl]phenyl] dihydrogen phosphate.
| Compound Name | [4-[[(6S,9S,9aS)-1-(benzylcarbamoyl)-2,9-dimethyl-8-(naphthalen-1-ylmethyl)-4,7-dioxo-3,6,9,9a-tetrahydropyrazino[2,1-c][1,2,4]triazin-6-yl]methyl]phenyl] dihydrogen phosphate |
|---|---|
| PubChem CID | 90347921 |
| Molecular Formula | C34H36N5O7P |
| Molecular Weight | 657.66 g/mol |
| Exact Mass | 657.24 |
| IUPAC Name | [4-[[(6S,9S,9aS)-1-(benzylcarbamoyl)-2,9-dimethyl-8-(naphthalen-1-ylmethyl)-4,7-dioxo-3,6,9,9a-tetrahydropyrazino[2,1-c][1,2,4]triazin-6-yl]methyl]phenyl] dihydrogen phosphate |
| SMILES | C[C@H]1[C@H]2N(C(=O)CN(C)N2C(=O)NCc2ccccc2)[C@@H](Cc2ccc(OP(=O)(O)O)cc2)C(=O)N1Cc1cccc2ccccc12 |
| InChI | InChI=1S/C34H36N5O7P/c1-23-32-38(31(40)22-36(2)39(32)34(42)35-20-25-9-4-3-5-10-25)30(19-24-15-17-28(18-16-24)46-47(43,44)45)33(41)37(23)21-27-13-8-12-26-11-6-7-14-29(26)27/h3-18,23,30,32H,19-22H2,1-2H3,(H,35,42)(H2,43,44,45)/t23-,30-,32-/m0/s1 |
| InChIKey | AXGDLBYEDGLAJD-MCESMFKASA-N |
| XLogP | 3.88 |
| TPSA | 142.96 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 47 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 657.66 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|