C38H43N6O6P — CID 88871140
2-[4-[[(6S,9aS)-1-(benzylcarbamoyl)-2-methyl-8-(naphthalen-1-ylmethyl)-4,7-dioxo-3,6,9,9a-tetrahydropyrazino[2,1-c][1,2,4]triazin-6-yl]methyl]anilino]prop-2-enyl-ethoxyphosphinic acid (PubChem CID 88871140) has the molecular formula C38H43N6O6P and a molecular weight of 710.77 g/mol. Its IUPAC name is 2-[4-[[(6S,9aS)-1-(benzylcarbamoyl)-2-methyl-8-(naphthalen-1-ylmethyl)-4,7-dioxo-3,6,9,9a-tetrahydropyrazino[2,1-c][1,2,4]triazin-6-yl]methyl]anilino]prop-2-enyl-ethoxyphosphinic acid.
| Compound Name | 2-[4-[[(6S,9aS)-1-(benzylcarbamoyl)-2-methyl-8-(naphthalen-1-ylmethyl)-4,7-dioxo-3,6,9,9a-tetrahydropyrazino[2,1-c][1,2,4]triazin-6-yl]methyl]anilino]prop-2-enyl-ethoxyphosphinic acid |
|---|---|
| PubChem CID | 88871140 |
| Molecular Formula | C38H43N6O6P |
| Molecular Weight | 710.77 g/mol |
| Exact Mass | 710.30 |
| IUPAC Name | 2-[4-[[(6S,9aS)-1-(benzylcarbamoyl)-2-methyl-8-(naphthalen-1-ylmethyl)-4,7-dioxo-3,6,9,9a-tetrahydropyrazino[2,1-c][1,2,4]triazin-6-yl]methyl]anilino]prop-2-enyl-ethoxyphosphinic acid |
| SMILES | C=C(CP(=O)(O)OCC)Nc1ccc(C[C@H]2C(=O)N(Cc3cccc4ccccc34)C[C@H]3N2C(=O)CN(C)N3C(=O)NCc2ccccc2)cc1 |
| InChI | InChI=1S/C38H43N6O6P/c1-4-50-51(48,49)26-27(2)40-32-19-17-28(18-20-32)21-34-37(46)42(23-31-15-10-14-30-13-8-9-16-33(30)31)24-35-43(34)36(45)25-41(3)44(35)38(47)39-22-29-11-6-5-7-12-29/h5-20,34-35,40H,2,4,21-26H2,1,3H3,(H,39,47)(H,48,49)/t34-,35-/m0/s1 |
| InChIKey | SLTSXDCEVCOSPE-PXLJZGITSA-N |
| XLogP | 5.17 |
| TPSA | 134.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 710.77 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|