C28H34FN5O6 — CID 58889730
3-[(6S,9aS)-1-[(4-fluorophenyl)methylcarbamoyl]-2-methyl-8-[2-[(4-methylphenyl)methoxy]ethyl]-4,7-dioxo-3,6,9,9a-tetrahydropyrazino[2,1-c][1,2,4]triazin-6-yl]propanoic acid (PubChem CID 58889730) has the molecular formula C28H34FN5O6 and a molecular weight of 555.61 g/mol. Its IUPAC name is 3-[(6S,9aS)-1-[(4-fluorophenyl)methylcarbamoyl]-2-methyl-8-[2-[(4-methylphenyl)methoxy]ethyl]-4,7-dioxo-3,6,9,9a-tetrahydropyrazino[2,1-c][1,2,4]triazin-6-yl]propanoic acid.
| Compound Name | 3-[(6S,9aS)-1-[(4-fluorophenyl)methylcarbamoyl]-2-methyl-8-[2-[(4-methylphenyl)methoxy]ethyl]-4,7-dioxo-3,6,9,9a-tetrahydropyrazino[2,1-c][1,2,4]triazin-6-yl]propanoic acid |
|---|---|
| PubChem CID | 58889730 |
| Molecular Formula | C28H34FN5O6 |
| Molecular Weight | 555.61 g/mol |
| Exact Mass | 555.25 |
| IUPAC Name | 3-[(6S,9aS)-1-[(4-fluorophenyl)methylcarbamoyl]-2-methyl-8-[2-[(4-methylphenyl)methoxy]ethyl]-4,7-dioxo-3,6,9,9a-tetrahydropyrazino[2,1-c][1,2,4]triazin-6-yl]propanoic acid |
| SMILES | Cc1ccc(COCCN2C[C@H]3N(C(=O)CN(C)N3C(=O)NCc3ccc(F)cc3)[C@@H](CCC(=O)O)C2=O)cc1 |
| InChI | InChI=1S/C28H34FN5O6/c1-19-3-5-21(6-4-19)18-40-14-13-32-16-24-33(23(27(32)38)11-12-26(36)37)25(35)17-31(2)34(24)28(39)30-15-20-7-9-22(29)10-8-20/h3-10,23-24H,11-18H2,1-2H3,(H,30,39)(H,36,37)/t23-,24-/m0/s1 |
| InChIKey | ZVUASFCUDRXIPA-ZEQRLZLVSA-N |
| XLogP | 1.95 |
| TPSA | 122.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 555.61 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|