C18H22N2O2 — CID 67411582
prop-2-enyl 4-(3,4,6,7-tetrahydro-2H-pyrrolo[1,2-a]pyrimidin-1-ylmethyl)benzoate (PubChem CID 67411582) has the molecular formula C18H22N2O2 and a molecular weight of 298.39 g/mol. Its IUPAC name is prop-2-enyl 4-(3,4,6,7-tetrahydro-2H-pyrrolo[1,2-a]pyrimidin-1-ylmethyl)benzoate.
| Compound Name | prop-2-enyl 4-(3,4,6,7-tetrahydro-2H-pyrrolo[1,2-a]pyrimidin-1-ylmethyl)benzoate |
|---|---|
| PubChem CID | 67411582 |
| Molecular Formula | C18H22N2O2 |
| Molecular Weight | 298.39 g/mol |
| Exact Mass | 298.17 |
| IUPAC Name | prop-2-enyl 4-(3,4,6,7-tetrahydro-2H-pyrrolo[1,2-a]pyrimidin-1-ylmethyl)benzoate |
| SMILES | C=CCOC(=O)c1ccc(CN2CCCN3CCC=C32)cc1 |
| InChI | InChI=1S/C18H22N2O2/c1-2-13-22-18(21)16-8-6-15(7-9-16)14-20-12-4-11-19-10-3-5-17(19)20/h2,5-9H,1,3-4,10-14H2 |
| InChIKey | MSPPKEGQMFXTCN-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 32.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.39 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|