C24H29ClN2O2S — CID 19605277
2-(2-benzylsulfanyl-4-oxoazetidin-1-yl)-N-[6-(4-chlorophenyl)hexyl]acetamide (PubChem CID 19605277) has the molecular formula C24H29ClN2O2S and a molecular weight of 445.03 g/mol. Its IUPAC name is 2-(2-benzylsulfanyl-4-oxoazetidin-1-yl)-N-[6-(4-chlorophenyl)hexyl]acetamide.
| Compound Name | 2-(2-benzylsulfanyl-4-oxoazetidin-1-yl)-N-[6-(4-chlorophenyl)hexyl]acetamide |
|---|---|
| PubChem CID | 19605277 |
| Molecular Formula | C24H29ClN2O2S |
| Molecular Weight | 445.03 g/mol |
| Exact Mass | 444.16 |
| IUPAC Name | 2-(2-benzylsulfanyl-4-oxoazetidin-1-yl)-N-[6-(4-chlorophenyl)hexyl]acetamide |
| SMILES | O=C(CN1C(=O)CC1SCc1ccccc1)NCCCCCCc1ccc(Cl)cc1 |
| InChI | InChI=1S/C24H29ClN2O2S/c25-21-13-11-19(12-14-21)8-4-1-2-7-15-26-22(28)17-27-23(29)16-24(27)30-18-20-9-5-3-6-10-20/h3,5-6,9-14,24H,1-2,4,7-8,15-18H2,(H,26,28) |
| InChIKey | JJSNUJZOASUCRS-UHFFFAOYSA-N |
| XLogP | 5.05 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.03 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|