C24H28N2O3S — CID 19605348
N-[2-(2-benzylsulfanyl-4-oxoazetidin-1-yl)acetyl]-6-phenylhexanamide (PubChem CID 19605348) has the molecular formula C24H28N2O3S and a molecular weight of 424.57 g/mol. Its IUPAC name is N-[2-(2-benzylsulfanyl-4-oxoazetidin-1-yl)acetyl]-6-phenylhexanamide.
| Compound Name | N-[2-(2-benzylsulfanyl-4-oxoazetidin-1-yl)acetyl]-6-phenylhexanamide |
|---|---|
| PubChem CID | 19605348 |
| Molecular Formula | C24H28N2O3S |
| Molecular Weight | 424.57 g/mol |
| Exact Mass | 424.18 |
| IUPAC Name | N-[2-(2-benzylsulfanyl-4-oxoazetidin-1-yl)acetyl]-6-phenylhexanamide |
| SMILES | O=C(CCCCCc1ccccc1)NC(=O)CN1C(=O)CC1SCc1ccccc1 |
| InChI | InChI=1S/C24H28N2O3S/c27-21(15-9-3-6-12-19-10-4-1-5-11-19)25-22(28)17-26-23(29)16-24(26)30-18-20-13-7-2-8-14-20/h1-2,4-5,7-8,10-11,13-14,24H,3,6,9,12,15-18H2,(H,25,27,28) |
| InChIKey | LLULUZYGUOWJOU-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.57 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|