C16H22N2O2 — CID 86273754
N-[(3R)-2-oxoazetidin-3-yl]-7-phenylheptanamide (PubChem CID 86273754) has the molecular formula C16H22N2O2 and a molecular weight of 274.36 g/mol. Its IUPAC name is N-[(3R)-2-oxoazetidin-3-yl]-7-phenylheptanamide.
| Compound Name | N-[(3R)-2-oxoazetidin-3-yl]-7-phenylheptanamide |
|---|---|
| PubChem CID | 86273754 |
| Molecular Formula | C16H22N2O2 |
| Molecular Weight | 274.36 g/mol |
| Exact Mass | 274.17 |
| IUPAC Name | N-[(3R)-2-oxoazetidin-3-yl]-7-phenylheptanamide |
| SMILES | O=C(CCCCCCc1ccccc1)N[C@@H]1CNC1=O |
| InChI | InChI=1S/C16H22N2O2/c19-15(18-14-12-17-16(14)20)11-7-2-1-4-8-13-9-5-3-6-10-13/h3,5-6,9-10,14H,1-2,4,7-8,11-12H2,(H,17,20)(H,18,19)/t14-/m1/s1 |
| InChIKey | VYOXYWYRWZZCIM-CQSZACIVSA-N |
| XLogP | 1.79 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.36 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|