C16H20N2O2 — CID 123281150
N-[(2-oxoazetidin-3-ylidene)methyl]-6-phenylhexanamide (PubChem CID 123281150) has the molecular formula C16H20N2O2 and a molecular weight of 272.35 g/mol. Its IUPAC name is N-[(2-oxoazetidin-3-ylidene)methyl]-6-phenylhexanamide.
| Compound Name | N-[(2-oxoazetidin-3-ylidene)methyl]-6-phenylhexanamide |
|---|---|
| PubChem CID | 123281150 |
| Molecular Formula | C16H20N2O2 |
| Molecular Weight | 272.35 g/mol |
| Exact Mass | 272.15 |
| IUPAC Name | N-[(2-oxoazetidin-3-ylidene)methyl]-6-phenylhexanamide |
| SMILES | O=C(CCCCCc1ccccc1)NC=C1CNC1=O |
| InChI | InChI=1S/C16H20N2O2/c19-15(17-11-14-12-18-16(14)20)10-6-2-5-9-13-7-3-1-4-8-13/h1,3-4,7-8,11H,2,5-6,9-10,12H2,(H,17,19)(H,18,20) |
| InChIKey | WXPNYSCCMBYCJB-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.35 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|