About 1-benzyl-2,3-dimethyl-2H-imidazole
1-benzyl-2,3-dimethyl-2H-imidazole (PubChem CID 20534969) has the molecular formula C12H16N2
and a molecular weight of 188.27 g/mol. Its IUPAC name is 1-benzyl-2,3-dimethyl-2H-imidazole.
Molecular Properties
| Compound Name | 1-benzyl-2,3-dimethyl-2H-imidazole |
| PubChem CID | 20534969 |
| Molecular Formula | C12H16N2 |
| Molecular Weight | 188.27 g/mol |
| Exact Mass | 188.13 |
| IUPAC Name | 1-benzyl-2,3-dimethyl-2H-imidazole |
| SMILES | CC1N(C)C=CN1Cc1ccccc1 |
| InChI | InChI=1S/C12H16N2/c1-11-13(2)8-9-14(11)10-12-6-4-3-5-7-12/h3-9,11H,10H2,1-2H3 |
| InChIKey | GHJFCDMKENGLAX-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 188.27 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1-benzyl-2,3-dimethyl-2H-imidazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-benzyl-2,3-dimethyl-2H-imidazole?
The IUPAC name of 1-benzyl-2,3-dimethyl-2H-imidazole (CID 20534969) is 1-benzyl-2,3-dimethyl-2H-imidazole.
What is the SMILES notation for 1-benzyl-2,3-dimethyl-2H-imidazole?
The canonical SMILES for 1-benzyl-2,3-dimethyl-2H-imidazole is CC1N(C)C=CN1Cc1ccccc1.
What is the InChIKey of 1-benzyl-2,3-dimethyl-2H-imidazole?
The InChIKey is GHJFCDMKENGLAX-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H16N2/c1-11-13(2)8-9-14(11)10-12-6-4-3-5-7-12/h3-9,11H,10H2,1-2H3.
What are the key properties of 1-benzyl-2,3-dimethyl-2H-imidazole?
1-benzyl-2,3-dimethyl-2H-imidazole has a molecular weight of 188.27 g/mol, XLogP of 2.25, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-benzyl-2,3-dimethyl-2H-imidazole is sourced from PubChem (CID 20534969), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).