About CID 177436101
CID 177436101 (PubChem CID 177436101) has the molecular formula C20H20B2N4
and a molecular weight of 338.03 g/mol.
Molecular Properties
| Compound Name | CID 177436101 |
| PubChem CID | 177436101 |
| Molecular Formula | C20H20B2N4 |
| Molecular Weight | 338.03 g/mol |
| Exact Mass | 338.19 |
| IUPAC Name | — |
| SMILES | [B]1C2N([B]C3N1C=CN3Cc1ccccc1)C=CN2Cc1ccccc1 |
| InChI | InChI=1S/C20H20B2N4/c1-3-7-17(8-4-1)15-23-11-13-25-19(23)21-26-14-12-24(20(26)22-25)16-18-9-5-2-6-10-18/h1-14,19-20H,15-16H2 |
| InChIKey | BTSMWMFFWFWOHN-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 12.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 338.03 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze CID 177436101 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 177436101?
The IUPAC name of CID 177436101 (CID 177436101) is not available.
What is the SMILES notation for CID 177436101?
The canonical SMILES for CID 177436101 is [B]1C2N([B]C3N1C=CN3Cc1ccccc1)C=CN2Cc1ccccc1.
What is the InChIKey of CID 177436101?
The InChIKey is BTSMWMFFWFWOHN-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H20B2N4/c1-3-7-17(8-4-1)15-23-11-13-25-19(23)21-26-14-12-24(20(26)22-25)16-18-9-5-2-6-10-18/h1-14,19-20H,15-16H2.
What are the key properties of CID 177436101?
CID 177436101 has a molecular weight of 338.03 g/mol, XLogP of 2.38, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for CID 177436101 is sourced from PubChem (CID 177436101), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).