C17H18N2O — CID 131844665
(4S,5R)-1-benzyl-5-methyl-4-phenylimidazolidin-2-one (PubChem CID 131844665) has the molecular formula C17H18N2O and a molecular weight of 266.34 g/mol. Its IUPAC name is (4S,5R)-1-benzyl-5-methyl-4-phenylimidazolidin-2-one.
| Compound Name | (4S,5R)-1-benzyl-5-methyl-4-phenylimidazolidin-2-one |
|---|---|
| PubChem CID | 131844665 |
| Molecular Formula | C17H18N2O |
| Molecular Weight | 266.34 g/mol |
| Exact Mass | 266.14 |
| IUPAC Name | (4S,5R)-1-benzyl-5-methyl-4-phenylimidazolidin-2-one |
| SMILES | C[C@@H]1[C@H](c2ccccc2)NC(=O)N1Cc1ccccc1 |
| InChI | InChI=1S/C17H18N2O/c1-13-16(15-10-6-3-7-11-15)18-17(20)19(13)12-14-8-4-2-5-9-14/h2-11,13,16H,12H2,1H3,(H,18,20)/t13-,16-/m1/s1 |
| InChIKey | GETMYJSFUOTOER-CZUORRHYSA-N |
| XLogP | 3.34 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.34 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |