C28H26N2OP+ — CID 138962724
(4R)-1,3-dibenzyl-4,5-diphenyl-1,3,2-diazaphospholidin-2-ium 2-oxide (PubChem CID 138962724) has the molecular formula C28H26N2OP+ and a molecular weight of 437.50 g/mol. Its IUPAC name is (4R)-1,3-dibenzyl-4,5-diphenyl-1,3,2-diazaphospholidin-2-ium 2-oxide.
| Compound Name | (4R)-1,3-dibenzyl-4,5-diphenyl-1,3,2-diazaphospholidin-2-ium 2-oxide |
|---|---|
| PubChem CID | 138962724 |
| Molecular Formula | C28H26N2OP+ |
| Molecular Weight | 437.50 g/mol |
| Exact Mass | 437.18 |
| IUPAC Name | (4R)-1,3-dibenzyl-4,5-diphenyl-1,3,2-diazaphospholidin-2-ium 2-oxide |
| SMILES | O=[P+]1N(Cc2ccccc2)C(c2ccccc2)[C@@H](c2ccccc2)N1Cc1ccccc1 |
| InChI | InChI=1S/C28H26N2OP/c31-32-29(21-23-13-5-1-6-14-23)27(25-17-9-3-10-18-25)28(26-19-11-4-12-20-26)30(32)22-24-15-7-2-8-16-24/h1-20,27-28H,21-22H2/q+1/t27-,28?/m1/s1 |
| InChIKey | PQOWIURFGWDNSV-QXPUDEPPSA-N |
| XLogP | 7.14 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.50 |
| LogP ≤ 5 | 7.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|