C21H21NO3 — CID 11823874
(1R,2R,3R,4S)-2-benzamido-3-phenylbicyclo[2.2.1]heptane-2-carboxylic acid (PubChem CID 11823874) has the molecular formula C21H21NO3 and a molecular weight of 335.40 g/mol. Its IUPAC name is (1R,2R,3R,4S)-2-benzamido-3-phenylbicyclo[2.2.1]heptane-2-carboxylic acid.
| Compound Name | (1R,2R,3R,4S)-2-benzamido-3-phenylbicyclo[2.2.1]heptane-2-carboxylic acid |
|---|---|
| PubChem CID | 11823874 |
| Molecular Formula | C21H21NO3 |
| Molecular Weight | 335.40 g/mol |
| Exact Mass | 335.15 |
| IUPAC Name | (1R,2R,3R,4S)-2-benzamido-3-phenylbicyclo[2.2.1]heptane-2-carboxylic acid |
| SMILES | O=C(N[C@]1(C(=O)O)[C@@H]2CC[C@@H](C2)[C@@H]1c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C21H21NO3/c23-19(15-9-5-2-6-10-15)22-21(20(24)25)17-12-11-16(13-17)18(21)14-7-3-1-4-8-14/h1-10,16-18H,11-13H2,(H,22,23)(H,24,25)/t16-,17+,18-,21+/m0/s1 |
| InChIKey | ORTQDMBCHJAFBW-TWFHAPMSSA-N |
| XLogP | 3.45 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.40 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |